C9H13N — CID 168719953
1,2,2,3,3a,4,4,5-octadeuterio-3-methylindole (PubChem CID 168719953) has the molecular formula C9H13N and a molecular weight of 143.26 g/mol. Its IUPAC name is 1,2,2,3,3a,4,4,5-octadeuterio-3-methylindole.
| Compound Name | 1,2,2,3,3a,4,4,5-octadeuterio-3-methylindole |
|---|---|
| PubChem CID | 168719953 |
| Molecular Formula | C9H13N |
| Molecular Weight | 143.26 g/mol |
| Exact Mass | 143.16 |
| IUPAC Name | 1,2,2,3,3a,4,4,5-octadeuterio-3-methylindole |
| SMILES | [2H]C1=CC=C2N([2H])C([2H])([2H])C([2H])(C)C2([2H])C1([2H])[2H] |
| InChI | InChI=1S/C9H13N/c1-7-6-10-9-5-3-2-4-8(7)9/h2-3,5,7-8,10H,4,6H2,1H3/i2D,4D2,6D2,7D,8D/hD |
| InChIKey | LSQNEPWUPMSSPP-SHXIUFPHSA-N |
| XLogP | 1.69 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 143.26 |
| LogP ≤ 5 | 1.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |