About 3-oxopentyl N-[2-(diethylamino)-10H-phenothiazin-1-yl]carbamate
3-oxopentyl N-[2-(diethylamino)-10H-phenothiazin-1-yl]carbamate (PubChem CID 168720008) has the molecular formula C22H27N3O3S
and a molecular weight of 413.54 g/mol. Its IUPAC name is 3-oxopentyl N-[2-(diethylamino)-10H-phenothiazin-1-yl]carbamate.
Molecular Properties
| Compound Name | 3-oxopentyl N-[2-(diethylamino)-10H-phenothiazin-1-yl]carbamate |
| PubChem CID | 168720008 |
| Molecular Formula | C22H27N3O3S |
| Molecular Weight | 413.54 g/mol |
| Exact Mass | 413.18 |
| IUPAC Name | 3-oxopentyl N-[2-(diethylamino)-10H-phenothiazin-1-yl]carbamate |
| SMILES | CCC(=O)CCOC(=O)Nc1c(N(CC)CC)ccc2c1Nc1ccccc1S2 |
| InChI | InChI=1S/C22H27N3O3S/c1-4-15(26)13-14-28-22(27)24-20-17(25(5-2)6-3)11-12-19-21(20)23-16-9-7-8-10-18(16)29-19/h7-12,23H,4-6,13-14H2,1-3H3,(H,24,27) |
| InChIKey | IUULPBITQZBIHC-UHFFFAOYSA-N |
| XLogP | 5.66 |
| TPSA | 70.67 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 413.54 |
| LogP ≤ 5 | 5.66 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze 3-oxopentyl N-[2-(diethylamino)-10H-phenothiazin-1-yl]carbamate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-oxopentyl N-[2-(diethylamino)-10H-phenothiazin-1-yl]carbamate?
The IUPAC name of 3-oxopentyl N-[2-(diethylamino)-10H-phenothiazin-1-yl]carbamate (CID 168720008) is 3-oxopentyl N-[2-(diethylamino)-10H-phenothiazin-1-yl]carbamate.
What is the SMILES notation for 3-oxopentyl N-[2-(diethylamino)-10H-phenothiazin-1-yl]carbamate?
The canonical SMILES for 3-oxopentyl N-[2-(diethylamino)-10H-phenothiazin-1-yl]carbamate is CCC(=O)CCOC(=O)Nc1c(N(CC)CC)ccc2c1Nc1ccccc1S2.
What is the InChIKey of 3-oxopentyl N-[2-(diethylamino)-10H-phenothiazin-1-yl]carbamate?
The InChIKey is IUULPBITQZBIHC-UHFFFAOYSA-N. The full InChI is InChI=1S/C22H27N3O3S/c1-4-15(26)13-14-28-22(27)24-20-17(25(5-2)6-3)11-12-19-21(20)23-16-9-7-8-10-18(16)29-19/h7-12,23H,4-6,13-14H2,1-3H3,(H,24,27).
What are the key properties of 3-oxopentyl N-[2-(diethylamino)-10H-phenothiazin-1-yl]carbamate?
3-oxopentyl N-[2-(diethylamino)-10H-phenothiazin-1-yl]carbamate has a molecular weight of 413.54 g/mol, XLogP of 5.66, 8 rotatable bonds, 2 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 3-oxopentyl N-[2-(diethylamino)-10H-phenothiazin-1-yl]carbamate is sourced from PubChem (CID 168720008), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).