C24H27F2NO5 — CID 168720273
(4,4-difluoro-2-methylidene-5-morpholin-4-yl-5-oxopentyl) (2S)-2-(6-methoxynaphthalen-2-yl)propanoate (PubChem CID 168720273) has the molecular formula C24H27F2NO5 and a molecular weight of 447.48 g/mol. Its IUPAC name is (4,4-difluoro-2-methylidene-5-morpholin-4-yl-5-oxopentyl) (2S)-2-(6-methoxynaphthalen-2-yl)propanoate.
| Compound Name | (4,4-difluoro-2-methylidene-5-morpholin-4-yl-5-oxopentyl) (2S)-2-(6-methoxynaphthalen-2-yl)propanoate |
|---|---|
| PubChem CID | 168720273 |
| Molecular Formula | C24H27F2NO5 |
| Molecular Weight | 447.48 g/mol |
| Exact Mass | 447.19 |
| IUPAC Name | (4,4-difluoro-2-methylidene-5-morpholin-4-yl-5-oxopentyl) (2S)-2-(6-methoxynaphthalen-2-yl)propanoate |
| SMILES | C=C(COC(=O)[C@@H](C)c1ccc2cc(OC)ccc2c1)CC(F)(F)C(=O)N1CCOCC1 |
| InChI | InChI=1S/C24H27F2NO5/c1-16(14-24(25,26)23(29)27-8-10-31-11-9-27)15-32-22(28)17(2)18-4-5-20-13-21(30-3)7-6-19(20)12-18/h4-7,12-13,17H,1,8-11,14-15H2,2-3H3/t17-/m0/s1 |
| InChIKey | LOPZIWRBKFLGAE-KRWDZBQOSA-N |
| XLogP | 3.94 |
| TPSA | 65.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 447.48 |
| LogP ≤ 5 | 3.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|