About 3-(cyclohexen-1-yl)-2,2-difluoro-1-morpholin-4-ylpropan-1-one
3-(cyclohexen-1-yl)-2,2-difluoro-1-morpholin-4-ylpropan-1-one (PubChem CID 168720314) has the molecular formula C13H19F2NO2
and a molecular weight of 259.30 g/mol. Its IUPAC name is 3-(cyclohexen-1-yl)-2,2-difluoro-1-morpholin-4-ylpropan-1-one.
Molecular Properties
| Compound Name | 3-(cyclohexen-1-yl)-2,2-difluoro-1-morpholin-4-ylpropan-1-one |
| PubChem CID | 168720314 |
| Molecular Formula | C13H19F2NO2 |
| Molecular Weight | 259.30 g/mol |
| Exact Mass | 259.14 |
| IUPAC Name | 3-(cyclohexen-1-yl)-2,2-difluoro-1-morpholin-4-ylpropan-1-one |
| SMILES | O=C(N1CCOCC1)C(F)(F)CC1=CCCCC1 |
| InChI | InChI=1S/C13H19F2NO2/c14-13(15,10-11-4-2-1-3-5-11)12(17)16-6-8-18-9-7-16/h4H,1-3,5-10H2 |
| InChIKey | XUBSWTKLQCNRJV-UHFFFAOYSA-N |
| XLogP | 2.37 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 259.30 |
| LogP ≤ 5 | 2.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 3-(cyclohexen-1-yl)-2,2-difluoro-1-morpholin-4-ylpropan-1-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-(cyclohexen-1-yl)-2,2-difluoro-1-morpholin-4-ylpropan-1-one?
The IUPAC name of 3-(cyclohexen-1-yl)-2,2-difluoro-1-morpholin-4-ylpropan-1-one (CID 168720314) is 3-(cyclohexen-1-yl)-2,2-difluoro-1-morpholin-4-ylpropan-1-one.
What is the SMILES notation for 3-(cyclohexen-1-yl)-2,2-difluoro-1-morpholin-4-ylpropan-1-one?
The canonical SMILES for 3-(cyclohexen-1-yl)-2,2-difluoro-1-morpholin-4-ylpropan-1-one is O=C(N1CCOCC1)C(F)(F)CC1=CCCCC1.
What is the InChIKey of 3-(cyclohexen-1-yl)-2,2-difluoro-1-morpholin-4-ylpropan-1-one?
The InChIKey is XUBSWTKLQCNRJV-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H19F2NO2/c14-13(15,10-11-4-2-1-3-5-11)12(17)16-6-8-18-9-7-16/h4H,1-3,5-10H2.
What are the key properties of 3-(cyclohexen-1-yl)-2,2-difluoro-1-morpholin-4-ylpropan-1-one?
3-(cyclohexen-1-yl)-2,2-difluoro-1-morpholin-4-ylpropan-1-one has a molecular weight of 259.30 g/mol, XLogP of 2.37, 3 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(cyclohexen-1-yl)-2,2-difluoro-1-morpholin-4-ylpropan-1-one is sourced from PubChem (CID 168720314), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).