C17H23N3 — CID 168721617
(1S,10R)-4,5,20-triazapentacyclo[8.7.3.01,9.03,7.012,17]icosa-12,14,16-triene (PubChem CID 168721617) has the molecular formula C17H23N3 and a molecular weight of 269.39 g/mol. Its IUPAC name is (1S,10R)-4,5,20-triazapentacyclo[8.7.3.01,9.03,7.012,17]icosa-12,14,16-triene.
| Compound Name | (1S,10R)-4,5,20-triazapentacyclo[8.7.3.01,9.03,7.012,17]icosa-12,14,16-triene |
|---|---|
| PubChem CID | 168721617 |
| Molecular Formula | C17H23N3 |
| Molecular Weight | 269.39 g/mol |
| Exact Mass | 269.19 |
| IUPAC Name | (1S,10R)-4,5,20-triazapentacyclo[8.7.3.01,9.03,7.012,17]icosa-12,14,16-triene |
| SMILES | c1ccc2c(c1)C[C@H]1NCC[C@@]23CC2NNCC2CC13 |
| InChI | InChI=1S/C17H23N3/c1-2-4-13-11(3-1)8-15-14-7-12-10-19-20-16(12)9-17(13,14)5-6-18-15/h1-4,12,14-16,18-20H,5-10H2/t12?,14?,15-,16?,17-/m1/s1 |
| InChIKey | BQYYDYYVXVSBCB-YDYIFSBISA-N |
| XLogP | 1.35 |
| TPSA | 36.09 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 269.39 |
| LogP ≤ 5 | 1.35 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |