About 4-hydroperoxy-1,2-diisocyanobenzene
4-hydroperoxy-1,2-diisocyanobenzene (PubChem CID 168726190) has the molecular formula C8H4N2O2
and a molecular weight of 160.13 g/mol. Its IUPAC name is 4-hydroperoxy-1,2-diisocyanobenzene.
Molecular Properties
| Compound Name | 4-hydroperoxy-1,2-diisocyanobenzene |
| PubChem CID | 168726190 |
| Molecular Formula | C8H4N2O2 |
| Molecular Weight | 160.13 g/mol |
| Exact Mass | 160.03 |
| IUPAC Name | 4-hydroperoxy-1,2-diisocyanobenzene |
| SMILES | [C-]#[N+]c1ccc(OO)cc1[N+]#[C-] |
| InChI | InChI=1S/C8H4N2O2/c1-9-7-4-3-6(12-11)5-8(7)10-2/h3-5,11H |
| InChIKey | KECDDSNQKRMXLZ-UHFFFAOYSA-N |
| XLogP | 2.64 |
| TPSA | 38.18 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 160.13 |
| LogP ≤ 5 | 2.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|
Analyze 4-hydroperoxy-1,2-diisocyanobenzene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-hydroperoxy-1,2-diisocyanobenzene?
The IUPAC name of 4-hydroperoxy-1,2-diisocyanobenzene (CID 168726190) is 4-hydroperoxy-1,2-diisocyanobenzene.
What is the SMILES notation for 4-hydroperoxy-1,2-diisocyanobenzene?
The canonical SMILES for 4-hydroperoxy-1,2-diisocyanobenzene is [C-]#[N+]c1ccc(OO)cc1[N+]#[C-].
What is the InChIKey of 4-hydroperoxy-1,2-diisocyanobenzene?
The InChIKey is KECDDSNQKRMXLZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H4N2O2/c1-9-7-4-3-6(12-11)5-8(7)10-2/h3-5,11H.
What are the key properties of 4-hydroperoxy-1,2-diisocyanobenzene?
4-hydroperoxy-1,2-diisocyanobenzene has a molecular weight of 160.13 g/mol, XLogP of 2.64, 1 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 4-hydroperoxy-1,2-diisocyanobenzene is sourced from PubChem (CID 168726190), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).