C21H37N3O3 — CID 168726926
tert-butyl 4-[(4-propan-2-yl-1-bicyclo[2.2.2]octanyl)carbamoyl]piperazine-1-carboxylate (PubChem CID 168726926) has the molecular formula C21H37N3O3 and a molecular weight of 379.55 g/mol. Its IUPAC name is tert-butyl 4-[(4-propan-2-yl-1-bicyclo[2.2.2]octanyl)carbamoyl]piperazine-1-carboxylate.
| Compound Name | tert-butyl 4-[(4-propan-2-yl-1-bicyclo[2.2.2]octanyl)carbamoyl]piperazine-1-carboxylate |
|---|---|
| PubChem CID | 168726926 |
| Molecular Formula | C21H37N3O3 |
| Molecular Weight | 379.55 g/mol |
| Exact Mass | 379.28 |
| IUPAC Name | tert-butyl 4-[(4-propan-2-yl-1-bicyclo[2.2.2]octanyl)carbamoyl]piperazine-1-carboxylate |
| SMILES | CC(C)C12CCC(NC(=O)N3CCN(C(=O)OC(C)(C)C)CC3)(CC1)CC2 |
| InChI | InChI=1S/C21H37N3O3/c1-16(2)20-6-9-21(10-7-20,11-8-20)22-17(25)23-12-14-24(15-13-23)18(26)27-19(3,4)5/h16H,6-15H2,1-5H3,(H,22,25) |
| InChIKey | RTRHMLMSCLAKJB-UHFFFAOYSA-N |
| XLogP | 4.00 |
| TPSA | 61.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.55 |
| LogP ≤ 5 | 4.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |