About (4Z)-4-ethylidene-1,2-dimethyl-5-methylideneimidazole
(4Z)-4-ethylidene-1,2-dimethyl-5-methylideneimidazole (PubChem CID 168727601) has the molecular formula C8H12N2
and a molecular weight of 136.20 g/mol. Its IUPAC name is (4Z)-4-ethylidene-1,2-dimethyl-5-methylideneimidazole.
Molecular Properties
| Compound Name | (4Z)-4-ethylidene-1,2-dimethyl-5-methylideneimidazole |
| PubChem CID | 168727601 |
| Molecular Formula | C8H12N2 |
| Molecular Weight | 136.20 g/mol |
| Exact Mass | 136.10 |
| IUPAC Name | (4Z)-4-ethylidene-1,2-dimethyl-5-methylideneimidazole |
| SMILES | C=c1/c(=C/C)nc(C)n1C |
| InChI | InChI=1S/C8H12N2/c1-5-8-6(2)10(4)7(3)9-8/h5H,2H2,1,3-4H3/b8-5- |
| InChIKey | GFUNSNSQLKTRBX-YVMONPNESA-N |
| XLogP | -0.06 |
| TPSA | 17.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 136.20 |
| LogP ≤ 5 | -0.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze (4Z)-4-ethylidene-1,2-dimethyl-5-methylideneimidazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (4Z)-4-ethylidene-1,2-dimethyl-5-methylideneimidazole?
The IUPAC name of (4Z)-4-ethylidene-1,2-dimethyl-5-methylideneimidazole (CID 168727601) is (4Z)-4-ethylidene-1,2-dimethyl-5-methylideneimidazole.
What is the SMILES notation for (4Z)-4-ethylidene-1,2-dimethyl-5-methylideneimidazole?
The canonical SMILES for (4Z)-4-ethylidene-1,2-dimethyl-5-methylideneimidazole is C=c1/c(=C/C)nc(C)n1C.
What is the InChIKey of (4Z)-4-ethylidene-1,2-dimethyl-5-methylideneimidazole?
The InChIKey is GFUNSNSQLKTRBX-YVMONPNESA-N. The full InChI is InChI=1S/C8H12N2/c1-5-8-6(2)10(4)7(3)9-8/h5H,2H2,1,3-4H3/b8-5-.
What are the key properties of (4Z)-4-ethylidene-1,2-dimethyl-5-methylideneimidazole?
(4Z)-4-ethylidene-1,2-dimethyl-5-methylideneimidazole has a molecular weight of 136.20 g/mol, XLogP of -0.06, 0 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (4Z)-4-ethylidene-1,2-dimethyl-5-methylideneimidazole is sourced from PubChem (CID 168727601), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).