C24H27BrN4O3Si — CID 168727968
2-[[5-[(3-bromo-6,7-dihydro-5H-cyclopenta[b]pyridin-7-yl)oxy]-3-(1,3-oxazol-5-yl)indazol-1-yl]methoxy]ethyl-trimethylsilane (PubChem CID 168727968) has the molecular formula C24H27BrN4O3Si and a molecular weight of 527.50 g/mol. Its IUPAC name is 2-[[5-[(3-bromo-6,7-dihydro-5H-cyclopenta[b]pyridin-7-yl)oxy]-3-(1,3-oxazol-5-yl)indazol-1-yl]methoxy]ethyl-trimethylsilane.
| Compound Name | 2-[[5-[(3-bromo-6,7-dihydro-5H-cyclopenta[b]pyridin-7-yl)oxy]-3-(1,3-oxazol-5-yl)indazol-1-yl]methoxy]ethyl-trimethylsilane |
|---|---|
| PubChem CID | 168727968 |
| Molecular Formula | C24H27BrN4O3Si |
| Molecular Weight | 527.50 g/mol |
| Exact Mass | 526.10 |
| IUPAC Name | 2-[[5-[(3-bromo-6,7-dihydro-5H-cyclopenta[b]pyridin-7-yl)oxy]-3-(1,3-oxazol-5-yl)indazol-1-yl]methoxy]ethyl-trimethylsilane |
| SMILES | C[Si](C)(C)CCOCn1nc(-c2cnco2)c2cc(OC3CCc4cc(Br)cnc43)ccc21 |
| InChI | InChI=1S/C24H27BrN4O3Si/c1-33(2,3)9-8-30-15-29-20-6-5-18(11-19(20)24(28-29)22-13-26-14-31-22)32-21-7-4-16-10-17(25)12-27-23(16)21/h5-6,10-14,21H,4,7-9,15H2,1-3H3 |
| InChIKey | SZODEPAZHFOKNB-UHFFFAOYSA-N |
| XLogP | 6.23 |
| TPSA | 75.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 527.50 |
| LogP ≤ 5 | 6.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|