About 5-fluoro-4-hydroxy-2-(1,3-thiazol-2-yl)-1H-pyrimidin-6-one
5-fluoro-4-hydroxy-2-(1,3-thiazol-2-yl)-1H-pyrimidin-6-one (PubChem CID 168728235) has the molecular formula C7H4FN3O2S
and a molecular weight of 213.19 g/mol. Its IUPAC name is 5-fluoro-4-hydroxy-2-(1,3-thiazol-2-yl)-1H-pyrimidin-6-one.
Molecular Properties
| Compound Name | 5-fluoro-4-hydroxy-2-(1,3-thiazol-2-yl)-1H-pyrimidin-6-one |
| PubChem CID | 168728235 |
| Molecular Formula | C7H4FN3O2S |
| Molecular Weight | 213.19 g/mol |
| Exact Mass | 213.00 |
| IUPAC Name | 5-fluoro-4-hydroxy-2-(1,3-thiazol-2-yl)-1H-pyrimidin-6-one |
| SMILES | O=c1[nH]c(-c2nccs2)nc(O)c1F |
| InChI | InChI=1S/C7H4FN3O2S/c8-3-5(12)10-4(11-6(3)13)7-9-1-2-14-7/h1-2H,(H2,10,11,12,13) |
| InChIKey | FDBWDSJVMAXKAL-UHFFFAOYSA-N |
| XLogP | 0.74 |
| TPSA | 78.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 213.19 |
| LogP ≤ 5 | 0.74 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 5-fluoro-4-hydroxy-2-(1,3-thiazol-2-yl)-1H-pyrimidin-6-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-fluoro-4-hydroxy-2-(1,3-thiazol-2-yl)-1H-pyrimidin-6-one?
The IUPAC name of 5-fluoro-4-hydroxy-2-(1,3-thiazol-2-yl)-1H-pyrimidin-6-one (CID 168728235) is 5-fluoro-4-hydroxy-2-(1,3-thiazol-2-yl)-1H-pyrimidin-6-one.
What is the SMILES notation for 5-fluoro-4-hydroxy-2-(1,3-thiazol-2-yl)-1H-pyrimidin-6-one?
The canonical SMILES for 5-fluoro-4-hydroxy-2-(1,3-thiazol-2-yl)-1H-pyrimidin-6-one is O=c1[nH]c(-c2nccs2)nc(O)c1F.
What is the InChIKey of 5-fluoro-4-hydroxy-2-(1,3-thiazol-2-yl)-1H-pyrimidin-6-one?
The InChIKey is FDBWDSJVMAXKAL-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H4FN3O2S/c8-3-5(12)10-4(11-6(3)13)7-9-1-2-14-7/h1-2H,(H2,10,11,12,13).
What are the key properties of 5-fluoro-4-hydroxy-2-(1,3-thiazol-2-yl)-1H-pyrimidin-6-one?
5-fluoro-4-hydroxy-2-(1,3-thiazol-2-yl)-1H-pyrimidin-6-one has a molecular weight of 213.19 g/mol, XLogP of 0.74, 1 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 5-fluoro-4-hydroxy-2-(1,3-thiazol-2-yl)-1H-pyrimidin-6-one is sourced from PubChem (CID 168728235), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).