C10H17N7O9S — CID 168728662
[(3aS,4R,9S)-2-amino-5,10,10-trihydroxy-6-imino-9-(trioxidanylsulfanyloxy)-3a,4,8,9-tetrahydro-1H-pyrrolo[1,2-c]purin-4-yl]methyl carbamate (PubChem CID 168728662) has the molecular formula C10H17N7O9S and a molecular weight of 411.35 g/mol. Its IUPAC name is [(3aS,4R,9S)-2-amino-5,10,10-trihydroxy-6-imino-9-(trioxidanylsulfanyloxy)-3a,4,8,9-tetrahydro-1H-pyrrolo[1,2-c]purin-4-yl]methyl carbamate.
| Compound Name | [(3aS,4R,9S)-2-amino-5,10,10-trihydroxy-6-imino-9-(trioxidanylsulfanyloxy)-3a,4,8,9-tetrahydro-1H-pyrrolo[1,2-c]purin-4-yl]methyl carbamate |
|---|---|
| PubChem CID | 168728662 |
| Molecular Formula | C10H17N7O9S |
| Molecular Weight | 411.35 g/mol |
| Exact Mass | 411.08 |
| IUPAC Name | [(3aS,4R,9S)-2-amino-5,10,10-trihydroxy-6-imino-9-(trioxidanylsulfanyloxy)-3a,4,8,9-tetrahydro-1H-pyrrolo[1,2-c]purin-4-yl]methyl carbamate |
| SMILES | [H]/N=C1\N(O)[C@@H](COC(N)=O)C2N=C(N)NC23N1C[C@H](OSOOO)C3(O)O |
| InChI | InChI=1S/C10H17N7O9S/c11-6-14-5-3(2-23-8(13)18)17(21)7(12)16-1-4(24-27-26-25-22)10(19,20)9(5,16)15-6/h3-5,12,19-22H,1-2H2,(H2,13,18)(H3,11,14,15)/b12-7-/t3-,4-,5?,9?/m0/s1 |
| InChIKey | LKABQQYIGFQTKQ-MMXVKKOKSA-N |
| XLogP | -3.56 |
| TPSA | 241.67 Ų |
| H-Bond Donors | 8 |
| H-Bond Acceptors | 14 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.35 |
| LogP ≤ 5 | -3.56 |
| H-Bond Donors ≤ 5 | 8 |
| H-Bond Acceptors ≤ 10 | 14 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|