C21H18ClF2N3O — CID 168729633
4-[(6-chloro-3-pyridinyl)methyl]-2-(7,8-difluoroquinolin-3-yl)-6,6-dimethyl-4,5-dihydro-1,3-oxazine (PubChem CID 168729633) has the molecular formula C21H18ClF2N3O and a molecular weight of 401.84 g/mol. Its IUPAC name is 4-[(6-chloro-3-pyridinyl)methyl]-2-(7,8-difluoroquinolin-3-yl)-6,6-dimethyl-4,5-dihydro-1,3-oxazine.
| Compound Name | 4-[(6-chloro-3-pyridinyl)methyl]-2-(7,8-difluoroquinolin-3-yl)-6,6-dimethyl-4,5-dihydro-1,3-oxazine |
|---|---|
| PubChem CID | 168729633 |
| Molecular Formula | C21H18ClF2N3O |
| Molecular Weight | 401.84 g/mol |
| Exact Mass | 401.11 |
| IUPAC Name | 4-[(6-chloro-3-pyridinyl)methyl]-2-(7,8-difluoroquinolin-3-yl)-6,6-dimethyl-4,5-dihydro-1,3-oxazine |
| SMILES | CC1(C)CC(Cc2ccc(Cl)nc2)N=C(c2cnc3c(F)c(F)ccc3c2)O1 |
| InChI | InChI=1S/C21H18ClF2N3O/c1-21(2)9-15(7-12-3-6-17(22)25-10-12)27-20(28-21)14-8-13-4-5-16(23)18(24)19(13)26-11-14/h3-6,8,10-11,15H,7,9H2,1-2H3 |
| InChIKey | RKBLYTCXLIPRPD-UHFFFAOYSA-N |
| XLogP | 5.12 |
| TPSA | 47.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.84 |
| LogP ≤ 5 | 5.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|