C42H45N3OPt — CID 168730558
4-tert-butyl-2-[N-[[3-[3-[4-(2,2-dimethylpropyl)-2-methylphenyl]-4-methyl-2-pyridinyl]benzene-2-id-1-yl]iminomethyl]-2-methylanilino]phenol;platinum(2+) (PubChem CID 168730558) has the molecular formula C42H45N3OPt and a molecular weight of 802.92 g/mol. Its IUPAC name is 4-tert-butyl-2-[N-[[3-[3-[4-(2,2-dimethylpropyl)-2-methylphenyl]-4-methyl-2-pyridinyl]benzene-2-id-1-yl]iminomethyl]-2-methylanilino]phenol;platinum(2+).
| Compound Name | 4-tert-butyl-2-[N-[[3-[3-[4-(2,2-dimethylpropyl)-2-methylphenyl]-4-methyl-2-pyridinyl]benzene-2-id-1-yl]iminomethyl]-2-methylanilino]phenol;platinum(2+) |
|---|---|
| PubChem CID | 168730558 |
| Molecular Formula | C42H45N3OPt |
| Molecular Weight | 802.92 g/mol |
| Exact Mass | 802.32 |
| IUPAC Name | 4-tert-butyl-2-[N-[[3-[3-[4-(2,2-dimethylpropyl)-2-methylphenyl]-4-methyl-2-pyridinyl]benzene-2-id-1-yl]iminomethyl]-2-methylanilino]phenol;platinum(2+) |
| SMILES | Cc1cc(CC(C)(C)C)ccc1-c1c(C)ccnc1-c1[c-]c(/N=[C-]/N(c2ccccc2C)c2cc(C(C)(C)C)ccc2O)ccc1.[Pt+2] |
| InChI | InChI=1S/C42H45N3O.Pt/c1-28-13-10-11-16-36(28)45(37-25-33(42(7,8)9)18-20-38(37)46)27-44-34-15-12-14-32(24-34)40-39(29(2)21-22-43-40)35-19-17-31(23-30(35)3)26-41(4,5)6;/h10-23,25,46H,26H2,1-9H3;/q-2;+2 |
| InChIKey | ORHMNKZJOCPXEA-UHFFFAOYSA-N |
| XLogP | 11.11 |
| TPSA | 48.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 802.92 |
| LogP ≤ 5 | 11.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'enamine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|