C18H16N6O2 — CID 168731077
5-amino-4-(3-hydroxy-2,6-dimethylphenyl)-2,4,8,13-tetrazatricyclo[7.4.0.03,7]trideca-1(9),2,5,7,10,12-hexaene-6-carboxamide (PubChem CID 168731077) has the molecular formula C18H16N6O2 and a molecular weight of 348.37 g/mol. Its IUPAC name is 5-amino-4-(3-hydroxy-2,6-dimethylphenyl)-2,4,8,13-tetrazatricyclo[7.4.0.03,7]trideca-1(9),2,5,7,10,12-hexaene-6-carboxamide.
| Compound Name | 5-amino-4-(3-hydroxy-2,6-dimethylphenyl)-2,4,8,13-tetrazatricyclo[7.4.0.03,7]trideca-1(9),2,5,7,10,12-hexaene-6-carboxamide |
|---|---|
| PubChem CID | 168731077 |
| Molecular Formula | C18H16N6O2 |
| Molecular Weight | 348.37 g/mol |
| Exact Mass | 348.13 |
| IUPAC Name | 5-amino-4-(3-hydroxy-2,6-dimethylphenyl)-2,4,8,13-tetrazatricyclo[7.4.0.03,7]trideca-1(9),2,5,7,10,12-hexaene-6-carboxamide |
| SMILES | Cc1ccc(O)c(C)c1-n1c(N)c(C(N)=O)c2nc3cccnc3nc21 |
| InChI | InChI=1S/C18H16N6O2/c1-8-5-6-11(25)9(2)14(8)24-15(19)12(16(20)26)13-18(24)23-17-10(22-13)4-3-7-21-17/h3-7,25H,19H2,1-2H3,(H2,20,26) |
| InChIKey | BTIPDEGKIFVLAB-UHFFFAOYSA-N |
| XLogP | 1.97 |
| TPSA | 132.94 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.37 |
| LogP ≤ 5 | 1.97 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |