C30H27FNO+ — CID 168732247
10-tert-butyl-16-fluoro-3,6,24-trimethyl-12-oxa-24-azoniahexacyclo[11.11.1.02,11.04,9.015,20.021,25]pentacosa-1(24),2(11),3,5,7,9,13(25),14,16,18,20,22-dodecaene (PubChem CID 168732247) has the molecular formula C30H27FNO+ and a molecular weight of 436.55 g/mol. Its IUPAC name is 10-tert-butyl-16-fluoro-3,6,24-trimethyl-12-oxa-24-azoniahexacyclo[11.11.1.02,11.04,9.015,20.021,25]pentacosa-1(24),2(11),3,5,7,9,13(25),14,16,18,20,22-dodecaene.
| Compound Name | 10-tert-butyl-16-fluoro-3,6,24-trimethyl-12-oxa-24-azoniahexacyclo[11.11.1.02,11.04,9.015,20.021,25]pentacosa-1(24),2(11),3,5,7,9,13(25),14,16,18,20,22-dodecaene |
|---|---|
| PubChem CID | 168732247 |
| Molecular Formula | C30H27FNO+ |
| Molecular Weight | 436.55 g/mol |
| Exact Mass | 436.21 |
| IUPAC Name | 10-tert-butyl-16-fluoro-3,6,24-trimethyl-12-oxa-24-azoniahexacyclo[11.11.1.02,11.04,9.015,20.021,25]pentacosa-1(24),2(11),3,5,7,9,13(25),14,16,18,20,22-dodecaene |
| SMILES | Cc1ccc2c(C(C)(C)C)c3c(c(C)c2c1)-c1c2c(cc4c(F)cccc4c2cc[n+]1C)O3 |
| InChI | InChI=1S/C30H27FNO/c1-16-10-11-20-21(14-16)17(2)25-28-26-19(12-13-32(28)6)18-8-7-9-23(31)22(18)15-24(26)33-29(25)27(20)30(3,4)5/h7-15H,1-6H3/q+1 |
| InChIKey | STTDUQLULOHVDF-UHFFFAOYSA-N |
| XLogP | 7.80 |
| TPSA | 13.11 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.55 |
| LogP ≤ 5 | 7.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|