C34H36NS+ — CID 168732762
17-(2,2-dimethylpropyl)-3,24-dimethyl-10-(2-methylpropyl)-12-thia-24-azoniahexacyclo[11.11.1.02,11.04,9.014,19.021,25]pentacosa-1(24),2,4,6,8,10,13(25),14(19),15,17,20,22-dodecaene (PubChem CID 168732762) has the molecular formula C34H36NS+ and a molecular weight of 490.74 g/mol. Its IUPAC name is 17-(2,2-dimethylpropyl)-3,24-dimethyl-10-(2-methylpropyl)-12-thia-24-azoniahexacyclo[11.11.1.02,11.04,9.014,19.021,25]pentacosa-1(24),2,4,6,8,10,13(25),14(19),15,17,20,22-dodecaene.
| Compound Name | 17-(2,2-dimethylpropyl)-3,24-dimethyl-10-(2-methylpropyl)-12-thia-24-azoniahexacyclo[11.11.1.02,11.04,9.014,19.021,25]pentacosa-1(24),2,4,6,8,10,13(25),14(19),15,17,20,22-dodecaene |
|---|---|
| PubChem CID | 168732762 |
| Molecular Formula | C34H36NS+ |
| Molecular Weight | 490.74 g/mol |
| Exact Mass | 490.26 |
| IUPAC Name | 17-(2,2-dimethylpropyl)-3,24-dimethyl-10-(2-methylpropyl)-12-thia-24-azoniahexacyclo[11.11.1.02,11.04,9.014,19.021,25]pentacosa-1(24),2,4,6,8,10,13(25),14(19),15,17,20,22-dodecaene |
| SMILES | Cc1c2c(c(CC(C)C)c3ccccc13)Sc1c3ccc(CC(C)(C)C)cc3cc3cc[n+](C)c-2c13 |
| InChI | InChI=1S/C34H36NS/c1-20(2)16-28-27-11-9-8-10-25(27)21(3)29-31-30-23(14-15-35(31)7)18-24-17-22(19-34(4,5)6)12-13-26(24)32(30)36-33(28)29/h8-15,17-18,20H,16,19H2,1-7H3/q+1 |
| InChIKey | GLUWYPMGKWXLFH-UHFFFAOYSA-N |
| XLogP | 9.20 |
| TPSA | 3.88 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 490.74 |
| LogP ≤ 5 | 9.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|