C41H43NO3S2 — CID 168733176
[7-(2,2-dimethylpropyl)-4-[4-(2,2-dimethylpropyl)-7-methyl-3-methylsulfanylnaphthalen-2-yl]benzo[f]isoquinolin-5-yl] benzenesulfonate (PubChem CID 168733176) has the molecular formula C41H43NO3S2 and a molecular weight of 661.93 g/mol. Its IUPAC name is [7-(2,2-dimethylpropyl)-4-[4-(2,2-dimethylpropyl)-7-methyl-3-methylsulfanylnaphthalen-2-yl]benzo[f]isoquinolin-5-yl] benzenesulfonate.
| Compound Name | [7-(2,2-dimethylpropyl)-4-[4-(2,2-dimethylpropyl)-7-methyl-3-methylsulfanylnaphthalen-2-yl]benzo[f]isoquinolin-5-yl] benzenesulfonate |
|---|---|
| PubChem CID | 168733176 |
| Molecular Formula | C41H43NO3S2 |
| Molecular Weight | 661.93 g/mol |
| Exact Mass | 661.27 |
| IUPAC Name | [7-(2,2-dimethylpropyl)-4-[4-(2,2-dimethylpropyl)-7-methyl-3-methylsulfanylnaphthalen-2-yl]benzo[f]isoquinolin-5-yl] benzenesulfonate |
| SMILES | CSc1c(-c2nccc3c2c(OS(=O)(=O)c2ccccc2)cc2c(CC(C)(C)C)cccc23)cc2cc(C)ccc2c1CC(C)(C)C |
| InChI | InChI=1S/C41H43NO3S2/c1-26-17-18-30-28(21-26)22-34(39(46-8)35(30)25-41(5,6)7)38-37-32(19-20-42-38)31-16-12-13-27(24-40(2,3)4)33(31)23-36(37)45-47(43,44)29-14-10-9-11-15-29/h9-23H,24-25H2,1-8H3 |
| InChIKey | KSITZVJOJNMURQ-UHFFFAOYSA-N |
| XLogP | 11.18 |
| TPSA | 56.26 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 661.93 |
| LogP ≤ 5 | 11.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|