C33H31F3NS+ — CID 168733429
3,24-dimethyl-10-propan-2-yl-16-(3,3,3-trifluoro-2,2-dimethylpropyl)-12-thia-24-azoniahexacyclo[11.11.1.02,11.04,9.015,20.021,25]pentacosa-1(24),2,4,6,8,10,13,15,17,19,21(25),22-dodecaene (PubChem CID 168733429) has the molecular formula C33H31F3NS+ and a molecular weight of 530.68 g/mol. Its IUPAC name is 3,24-dimethyl-10-propan-2-yl-16-(3,3,3-trifluoro-2,2-dimethylpropyl)-12-thia-24-azoniahexacyclo[11.11.1.02,11.04,9.015,20.021,25]pentacosa-1(24),2,4,6,8,10,13,15,17,19,21(25),22-dodecaene.
| Compound Name | 3,24-dimethyl-10-propan-2-yl-16-(3,3,3-trifluoro-2,2-dimethylpropyl)-12-thia-24-azoniahexacyclo[11.11.1.02,11.04,9.015,20.021,25]pentacosa-1(24),2,4,6,8,10,13,15,17,19,21(25),22-dodecaene |
|---|---|
| PubChem CID | 168733429 |
| Molecular Formula | C33H31F3NS+ |
| Molecular Weight | 530.68 g/mol |
| Exact Mass | 530.21 |
| IUPAC Name | 3,24-dimethyl-10-propan-2-yl-16-(3,3,3-trifluoro-2,2-dimethylpropyl)-12-thia-24-azoniahexacyclo[11.11.1.02,11.04,9.015,20.021,25]pentacosa-1(24),2,4,6,8,10,13,15,17,19,21(25),22-dodecaene |
| SMILES | Cc1c2c(c(C(C)C)c3ccccc13)Sc1cc3c(CC(C)(C)C(F)(F)F)cccc3c3cc[n+](C)c-2c13 |
| InChI | InChI=1S/C33H31F3NS/c1-18(2)27-23-12-8-7-11-21(23)19(3)28-30-29-24(14-15-37(30)6)22-13-9-10-20(17-32(4,5)33(34,35)36)25(22)16-26(29)38-31(27)28/h7-16,18H,17H2,1-6H3/q+1 |
| InChIKey | FPBLEHYWCKIKSG-UHFFFAOYSA-N |
| XLogP | 9.67 |
| TPSA | 3.88 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 530.68 |
| LogP ≤ 5 | 9.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|