C32H30NO2+ — CID 168733617
3,6,10,24-tetramethyl-16-(oxan-4-yl)-12-oxa-24-azoniahexacyclo[11.11.1.02,11.04,9.015,20.021,25]pentacosa-1(24),2(11),3,5,7,9,13(25),14,16,18,20,22-dodecaene (PubChem CID 168733617) has the molecular formula C32H30NO2+ and a molecular weight of 460.60 g/mol. Its IUPAC name is 3,6,10,24-tetramethyl-16-(oxan-4-yl)-12-oxa-24-azoniahexacyclo[11.11.1.02,11.04,9.015,20.021,25]pentacosa-1(24),2(11),3,5,7,9,13(25),14,16,18,20,22-dodecaene.
| Compound Name | 3,6,10,24-tetramethyl-16-(oxan-4-yl)-12-oxa-24-azoniahexacyclo[11.11.1.02,11.04,9.015,20.021,25]pentacosa-1(24),2(11),3,5,7,9,13(25),14,16,18,20,22-dodecaene |
|---|---|
| PubChem CID | 168733617 |
| Molecular Formula | C32H30NO2+ |
| Molecular Weight | 460.60 g/mol |
| Exact Mass | 460.23 |
| IUPAC Name | 3,6,10,24-tetramethyl-16-(oxan-4-yl)-12-oxa-24-azoniahexacyclo[11.11.1.02,11.04,9.015,20.021,25]pentacosa-1(24),2(11),3,5,7,9,13(25),14,16,18,20,22-dodecaene |
| SMILES | Cc1ccc2c(C)c3c(c(C)c2c1)-c1c2c(cc4c(C5CCOCC5)cccc4c2cc[n+]1C)O3 |
| InChI | InChI=1S/C32H30NO2/c1-18-8-9-22-20(3)32-29(19(2)26(22)16-18)31-30-25(10-13-33(31)4)24-7-5-6-23(21-11-14-34-15-12-21)27(24)17-28(30)35-32/h5-10,13,16-17,21H,11-12,14-15H2,1-4H3/q+1 |
| InChIKey | GSXJWVVJYUWJRJ-UHFFFAOYSA-N |
| XLogP | 7.56 |
| TPSA | 22.34 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 460.60 |
| LogP ≤ 5 | 7.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|