About 8-[(6,8-difluoro-7-hydroxy-2-oxochromene-3-carbonyl)-methylamino]octyl N-methylcarbamate
8-[(6,8-difluoro-7-hydroxy-2-oxochromene-3-carbonyl)-methylamino]octyl N-methylcarbamate (PubChem CID 168735089) has the molecular formula C21H26F2N2O6
and a molecular weight of 440.44 g/mol. Its IUPAC name is 8-[(6,8-difluoro-7-hydroxy-2-oxochromene-3-carbonyl)-methylamino]octyl N-methylcarbamate.
Molecular Properties
| Compound Name | 8-[(6,8-difluoro-7-hydroxy-2-oxochromene-3-carbonyl)-methylamino]octyl N-methylcarbamate |
| PubChem CID | 168735089 |
| Molecular Formula | C21H26F2N2O6 |
| Molecular Weight | 440.44 g/mol |
| Exact Mass | 440.18 |
| IUPAC Name | 8-[(6,8-difluoro-7-hydroxy-2-oxochromene-3-carbonyl)-methylamino]octyl N-methylcarbamate |
| SMILES | CNC(=O)OCCCCCCCCN(C)C(=O)c1cc2cc(F)c(O)c(F)c2oc1=O |
| InChI | InChI=1S/C21H26F2N2O6/c1-24-21(29)30-10-8-6-4-3-5-7-9-25(2)19(27)14-11-13-12-15(22)17(26)16(23)18(13)31-20(14)28/h11-12,26H,3-10H2,1-2H3,(H,24,29) |
| InChIKey | IDTGFUHTJGWFJY-UHFFFAOYSA-N |
| XLogP | 3.55 |
| TPSA | 109.08 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 31 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 440.44 |
| LogP ≤ 5 | 3.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|
Analyze 8-[(6,8-difluoro-7-hydroxy-2-oxochromene-3-carbonyl)-methylamino]octyl N-methylcarbamate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 8-[(6,8-difluoro-7-hydroxy-2-oxochromene-3-carbonyl)-methylamino]octyl N-methylcarbamate?
The IUPAC name of 8-[(6,8-difluoro-7-hydroxy-2-oxochromene-3-carbonyl)-methylamino]octyl N-methylcarbamate (CID 168735089) is 8-[(6,8-difluoro-7-hydroxy-2-oxochromene-3-carbonyl)-methylamino]octyl N-methylcarbamate.
What is the SMILES notation for 8-[(6,8-difluoro-7-hydroxy-2-oxochromene-3-carbonyl)-methylamino]octyl N-methylcarbamate?
The canonical SMILES for 8-[(6,8-difluoro-7-hydroxy-2-oxochromene-3-carbonyl)-methylamino]octyl N-methylcarbamate is CNC(=O)OCCCCCCCCN(C)C(=O)c1cc2cc(F)c(O)c(F)c2oc1=O.
What is the InChIKey of 8-[(6,8-difluoro-7-hydroxy-2-oxochromene-3-carbonyl)-methylamino]octyl N-methylcarbamate?
The InChIKey is IDTGFUHTJGWFJY-UHFFFAOYSA-N. The full InChI is InChI=1S/C21H26F2N2O6/c1-24-21(29)30-10-8-6-4-3-5-7-9-25(2)19(27)14-11-13-12-15(22)17(26)16(23)18(13)31-20(14)28/h11-12,26H,3-10H2,1-2H3,(H,24,29).
What are the key properties of 8-[(6,8-difluoro-7-hydroxy-2-oxochromene-3-carbonyl)-methylamino]octyl N-methylcarbamate?
8-[(6,8-difluoro-7-hydroxy-2-oxochromene-3-carbonyl)-methylamino]octyl N-methylcarbamate has a molecular weight of 440.44 g/mol, XLogP of 3.55, 10 rotatable bonds, 2 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 8-[(6,8-difluoro-7-hydroxy-2-oxochromene-3-carbonyl)-methylamino]octyl N-methylcarbamate is sourced from PubChem (CID 168735089), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).