C22H12N4O3S — CID 168735432
2-[[4-methyl-5-(1,3-thiazol-2-yl)imidazo[4,5-d][1,3]oxazol-2-yl]methylidene]cyclopenta[b]naphthalene-1,3-dione (PubChem CID 168735432) has the molecular formula C22H12N4O3S and a molecular weight of 412.43 g/mol. Its IUPAC name is 2-[[4-methyl-5-(1,3-thiazol-2-yl)imidazo[4,5-d][1,3]oxazol-2-yl]methylidene]cyclopenta[b]naphthalene-1,3-dione.
| Compound Name | 2-[[4-methyl-5-(1,3-thiazol-2-yl)imidazo[4,5-d][1,3]oxazol-2-yl]methylidene]cyclopenta[b]naphthalene-1,3-dione |
|---|---|
| PubChem CID | 168735432 |
| Molecular Formula | C22H12N4O3S |
| Molecular Weight | 412.43 g/mol |
| Exact Mass | 412.06 |
| IUPAC Name | 2-[[4-methyl-5-(1,3-thiazol-2-yl)imidazo[4,5-d][1,3]oxazol-2-yl]methylidene]cyclopenta[b]naphthalene-1,3-dione |
| SMILES | Cn1c(-c2nccs2)nc2oc(C=C3C(=O)c4cc5ccccc5cc4C3=O)nc21 |
| InChI | InChI=1S/C22H12N4O3S/c1-26-19-21(25-20(26)22-23-6-7-30-22)29-16(24-19)10-15-17(27)13-8-11-4-2-3-5-12(11)9-14(13)18(15)28/h2-10H,1H3 |
| InChIKey | QDQUPTPTJJZYFF-UHFFFAOYSA-N |
| XLogP | 4.30 |
| TPSA | 90.88 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.43 |
| LogP ≤ 5 | 4.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'ene_five_one_A(55)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|