C21H13N3O3S — CID 168735560
(3Z)-3-[(4-methyl-5-phenylimidazo[4,5-d][1,3]thiazol-2-yl)methylidene]chromene-2,4-dione (PubChem CID 168735560) has the molecular formula C21H13N3O3S and a molecular weight of 387.42 g/mol. Its IUPAC name is (3Z)-3-[(4-methyl-5-phenylimidazo[4,5-d][1,3]thiazol-2-yl)methylidene]chromene-2,4-dione.
| Compound Name | (3Z)-3-[(4-methyl-5-phenylimidazo[4,5-d][1,3]thiazol-2-yl)methylidene]chromene-2,4-dione |
|---|---|
| PubChem CID | 168735560 |
| Molecular Formula | C21H13N3O3S |
| Molecular Weight | 387.42 g/mol |
| Exact Mass | 387.07 |
| IUPAC Name | (3Z)-3-[(4-methyl-5-phenylimidazo[4,5-d][1,3]thiazol-2-yl)methylidene]chromene-2,4-dione |
| SMILES | Cn1c(-c2ccccc2)nc2sc(/C=C3\C(=O)Oc4ccccc4C3=O)nc21 |
| InChI | InChI=1S/C21H13N3O3S/c1-24-18(12-7-3-2-4-8-12)23-20-19(24)22-16(28-20)11-14-17(25)13-9-5-6-10-15(13)27-21(14)26/h2-11H,1H3/b14-11- |
| InChIKey | KKMNUOMAKUSEMC-KAMYIIQDSA-N |
| XLogP | 3.88 |
| TPSA | 74.08 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.42 |
| LogP ≤ 5 | 3.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|