C28H17N5O2S — CID 168735678
2-[[6-methyl-3-phenyl-5-(1,3-thiazol-2-yl)imidazo[4,5-d]imidazol-2-yl]methylidene]cyclopenta[b]naphthalene-1,3-dione (PubChem CID 168735678) has the molecular formula C28H17N5O2S and a molecular weight of 487.54 g/mol. Its IUPAC name is 2-[[6-methyl-3-phenyl-5-(1,3-thiazol-2-yl)imidazo[4,5-d]imidazol-2-yl]methylidene]cyclopenta[b]naphthalene-1,3-dione.
| Compound Name | 2-[[6-methyl-3-phenyl-5-(1,3-thiazol-2-yl)imidazo[4,5-d]imidazol-2-yl]methylidene]cyclopenta[b]naphthalene-1,3-dione |
|---|---|
| PubChem CID | 168735678 |
| Molecular Formula | C28H17N5O2S |
| Molecular Weight | 487.54 g/mol |
| Exact Mass | 487.11 |
| IUPAC Name | 2-[[6-methyl-3-phenyl-5-(1,3-thiazol-2-yl)imidazo[4,5-d]imidazol-2-yl]methylidene]cyclopenta[b]naphthalene-1,3-dione |
| SMILES | Cn1c(-c2nccs2)nc2c1nc(C=C1C(=O)c3cc4ccccc4cc3C1=O)n2-c1ccccc1 |
| InChI | InChI=1S/C28H17N5O2S/c1-32-25-26(31-27(32)28-29-11-12-36-28)33(18-9-3-2-4-10-18)22(30-25)15-21-23(34)19-13-16-7-5-6-8-17(16)14-20(19)24(21)35/h2-15H,1H3 |
| InChIKey | VOPWDTBECVMWFC-UHFFFAOYSA-N |
| XLogP | 5.50 |
| TPSA | 82.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 487.54 |
| LogP ≤ 5 | 5.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'ene_five_one_A(55)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|