C21H7F4NO3S — CID 168735834
4,5,6,7-tetrafluoro-2-[(5-phenylfuro[2,3-d][1,3]thiazol-2-yl)methylidene]indene-1,3-dione (PubChem CID 168735834) has the molecular formula C21H7F4NO3S and a molecular weight of 429.35 g/mol. Its IUPAC name is 4,5,6,7-tetrafluoro-2-[(5-phenylfuro[2,3-d][1,3]thiazol-2-yl)methylidene]indene-1,3-dione.
| Compound Name | 4,5,6,7-tetrafluoro-2-[(5-phenylfuro[2,3-d][1,3]thiazol-2-yl)methylidene]indene-1,3-dione |
|---|---|
| PubChem CID | 168735834 |
| Molecular Formula | C21H7F4NO3S |
| Molecular Weight | 429.35 g/mol |
| Exact Mass | 429.01 |
| IUPAC Name | 4,5,6,7-tetrafluoro-2-[(5-phenylfuro[2,3-d][1,3]thiazol-2-yl)methylidene]indene-1,3-dione |
| SMILES | O=C1C(=Cc2nc3oc(-c4ccccc4)cc3s2)C(=O)c2c(F)c(F)c(F)c(F)c21 |
| InChI | InChI=1S/C21H7F4NO3S/c22-15-13-14(16(23)18(25)17(15)24)20(28)9(19(13)27)6-12-26-21-11(30-12)7-10(29-21)8-4-2-1-3-5-8/h1-7H |
| InChIKey | FXFKPPJIPGQHIH-UHFFFAOYSA-N |
| XLogP | 5.58 |
| TPSA | 60.17 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 429.35 |
| LogP ≤ 5 | 5.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'ene_five_one_A(55)', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|