C26H10N6OS — CID 168735851
2-[(2Z,3Z)-3-[cyano(isocyano)methylidene]-2-[(5-phenyl-[1,3]thiazolo[5,4-d][1,3]oxazol-2-yl)methylidene]inden-1-ylidene]propanedinitrile (PubChem CID 168735851) has the molecular formula C26H10N6OS and a molecular weight of 454.47 g/mol. Its IUPAC name is 2-[(2Z,3Z)-3-[cyano(isocyano)methylidene]-2-[(5-phenyl-[1,3]thiazolo[5,4-d][1,3]oxazol-2-yl)methylidene]inden-1-ylidene]propanedinitrile.
| Compound Name | 2-[(2Z,3Z)-3-[cyano(isocyano)methylidene]-2-[(5-phenyl-[1,3]thiazolo[5,4-d][1,3]oxazol-2-yl)methylidene]inden-1-ylidene]propanedinitrile |
|---|---|
| PubChem CID | 168735851 |
| Molecular Formula | C26H10N6OS |
| Molecular Weight | 454.47 g/mol |
| Exact Mass | 454.06 |
| IUPAC Name | 2-[(2Z,3Z)-3-[cyano(isocyano)methylidene]-2-[(5-phenyl-[1,3]thiazolo[5,4-d][1,3]oxazol-2-yl)methylidene]inden-1-ylidene]propanedinitrile |
| SMILES | [C-]#[N+]/C(C#N)=C1C(=C/c2nc3sc(-c4ccccc4)nc3o2)\C(=C(C#N)C#N)c2ccccc2\1 |
| InChI | InChI=1S/C26H10N6OS/c1-30-20(14-29)23-18-10-6-5-9-17(18)22(16(12-27)13-28)19(23)11-21-31-26-24(33-21)32-25(34-26)15-7-3-2-4-8-15/h2-11H/b19-11-,23-20- |
| InChIKey | HJBULVDREBHMHD-GXPQSAKWSA-N |
| XLogP | 6.00 |
| TPSA | 114.65 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 454.47 |
| LogP ≤ 5 | 6.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'ene_cyano_A(19)', 'substructure': 'N/A'}, {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'} |
|---|