C28H17F2N3O2 — CID 168736035
4,7-difluoro-2-[(4-methyl-1,5-diphenylpyrrolo[2,3-d]imidazol-2-yl)methylidene]indene-1,3-dione (PubChem CID 168736035) has the molecular formula C28H17F2N3O2 and a molecular weight of 465.46 g/mol. Its IUPAC name is 4,7-difluoro-2-[(4-methyl-1,5-diphenylpyrrolo[2,3-d]imidazol-2-yl)methylidene]indene-1,3-dione.
| Compound Name | 4,7-difluoro-2-[(4-methyl-1,5-diphenylpyrrolo[2,3-d]imidazol-2-yl)methylidene]indene-1,3-dione |
|---|---|
| PubChem CID | 168736035 |
| Molecular Formula | C28H17F2N3O2 |
| Molecular Weight | 465.46 g/mol |
| Exact Mass | 465.13 |
| IUPAC Name | 4,7-difluoro-2-[(4-methyl-1,5-diphenylpyrrolo[2,3-d]imidazol-2-yl)methylidene]indene-1,3-dione |
| SMILES | Cn1c(-c2ccccc2)cc2c1nc(C=C1C(=O)c3c(F)ccc(F)c3C1=O)n2-c1ccccc1 |
| InChI | InChI=1S/C28H17F2N3O2/c1-32-21(16-8-4-2-5-9-16)15-22-28(32)31-23(33(22)17-10-6-3-7-11-17)14-18-26(34)24-19(29)12-13-20(30)25(24)27(18)35/h2-15H,1H3 |
| InChIKey | NJKYEDSQKGJBAR-UHFFFAOYSA-N |
| XLogP | 5.77 |
| TPSA | 56.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 465.46 |
| LogP ≤ 5 | 5.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'ene_five_one_A(55)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|