C24H13N3O3 — CID 168736087
2-[(2-phenyl-4H-imidazo[4,5-d][1,3]oxazol-5-yl)methylidene]cyclopenta[b]naphthalene-1,3-dione (PubChem CID 168736087) has the molecular formula C24H13N3O3 and a molecular weight of 391.39 g/mol. Its IUPAC name is 2-[(2-phenyl-4H-imidazo[4,5-d][1,3]oxazol-5-yl)methylidene]cyclopenta[b]naphthalene-1,3-dione.
| Compound Name | 2-[(2-phenyl-4H-imidazo[4,5-d][1,3]oxazol-5-yl)methylidene]cyclopenta[b]naphthalene-1,3-dione |
|---|---|
| PubChem CID | 168736087 |
| Molecular Formula | C24H13N3O3 |
| Molecular Weight | 391.39 g/mol |
| Exact Mass | 391.10 |
| IUPAC Name | 2-[(2-phenyl-4H-imidazo[4,5-d][1,3]oxazol-5-yl)methylidene]cyclopenta[b]naphthalene-1,3-dione |
| SMILES | O=C1C(=Cc2nc3oc(-c4ccccc4)nc3[nH]2)C(=O)c2cc3ccccc3cc21 |
| InChI | InChI=1S/C24H13N3O3/c28-20-16-10-14-8-4-5-9-15(14)11-17(16)21(29)18(20)12-19-25-22-24(26-19)30-23(27-22)13-6-2-1-3-7-13/h1-12H,(H,25,26) |
| InChIKey | PUQVQSMEYSFAMH-UHFFFAOYSA-N |
| XLogP | 4.83 |
| TPSA | 88.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.39 |
| LogP ≤ 5 | 4.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'ene_five_one_A(55)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|