C24H7F5N2O2S2 — CID 168736108
2-[[5-(2,3,4,5,6-pentafluorophenyl)-[1,3]thiazolo[5,4-d][1,3]thiazol-2-yl]methylidene]cyclopenta[b]naphthalene-1,3-dione (PubChem CID 168736108) has the molecular formula C24H7F5N2O2S2 and a molecular weight of 514.46 g/mol. Its IUPAC name is 2-[[5-(2,3,4,5,6-pentafluorophenyl)-[1,3]thiazolo[5,4-d][1,3]thiazol-2-yl]methylidene]cyclopenta[b]naphthalene-1,3-dione.
| Compound Name | 2-[[5-(2,3,4,5,6-pentafluorophenyl)-[1,3]thiazolo[5,4-d][1,3]thiazol-2-yl]methylidene]cyclopenta[b]naphthalene-1,3-dione |
|---|---|
| PubChem CID | 168736108 |
| Molecular Formula | C24H7F5N2O2S2 |
| Molecular Weight | 514.46 g/mol |
| Exact Mass | 513.99 |
| IUPAC Name | 2-[[5-(2,3,4,5,6-pentafluorophenyl)-[1,3]thiazolo[5,4-d][1,3]thiazol-2-yl]methylidene]cyclopenta[b]naphthalene-1,3-dione |
| SMILES | O=C1C(=Cc2nc3sc(-c4c(F)c(F)c(F)c(F)c4F)nc3s2)C(=O)c2cc3ccccc3cc21 |
| InChI | InChI=1S/C24H7F5N2O2S2/c25-15-14(16(26)18(28)19(29)17(15)27)22-31-24-23(35-22)30-13(34-24)7-12-20(32)10-5-8-3-1-2-4-9(8)6-11(10)21(12)33/h1-7H |
| InChIKey | BQOVGOFQLHZPER-UHFFFAOYSA-N |
| XLogP | 6.73 |
| TPSA | 59.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 514.46 |
| LogP ≤ 5 | 6.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'ene_five_one_A(55)', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|