C25H8F5NO2S2 — CID 168736110
2-[[5-(2,3,4,5,6-pentafluorophenyl)thieno[2,3-d][1,3]thiazol-2-yl]methylidene]cyclopenta[b]naphthalene-1,3-dione (PubChem CID 168736110) has the molecular formula C25H8F5NO2S2 and a molecular weight of 513.47 g/mol. Its IUPAC name is 2-[[5-(2,3,4,5,6-pentafluorophenyl)thieno[2,3-d][1,3]thiazol-2-yl]methylidene]cyclopenta[b]naphthalene-1,3-dione.
| Compound Name | 2-[[5-(2,3,4,5,6-pentafluorophenyl)thieno[2,3-d][1,3]thiazol-2-yl]methylidene]cyclopenta[b]naphthalene-1,3-dione |
|---|---|
| PubChem CID | 168736110 |
| Molecular Formula | C25H8F5NO2S2 |
| Molecular Weight | 513.47 g/mol |
| Exact Mass | 512.99 |
| IUPAC Name | 2-[[5-(2,3,4,5,6-pentafluorophenyl)thieno[2,3-d][1,3]thiazol-2-yl]methylidene]cyclopenta[b]naphthalene-1,3-dione |
| SMILES | O=C1C(=Cc2nc3sc(-c4c(F)c(F)c(F)c(F)c4F)cc3s2)C(=O)c2cc3ccccc3cc21 |
| InChI | InChI=1S/C25H8F5NO2S2/c26-18-17(19(27)21(29)22(30)20(18)28)14-8-15-25(35-14)31-16(34-15)7-13-23(32)11-5-9-3-1-2-4-10(9)6-12(11)24(13)33/h1-8H |
| InChIKey | QEWMQITYJCNFGU-UHFFFAOYSA-N |
| XLogP | 7.34 |
| TPSA | 47.03 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 513.47 |
| LogP ≤ 5 | 7.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'ene_five_one_A(55)', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|