C21H9F2NO3S — CID 168736132
4,7-difluoro-2-[(5-phenylthieno[2,3-d][1,3]oxazol-2-yl)methylidene]indene-1,3-dione (PubChem CID 168736132) has the molecular formula C21H9F2NO3S and a molecular weight of 393.37 g/mol. Its IUPAC name is 4,7-difluoro-2-[(5-phenylthieno[2,3-d][1,3]oxazol-2-yl)methylidene]indene-1,3-dione.
| Compound Name | 4,7-difluoro-2-[(5-phenylthieno[2,3-d][1,3]oxazol-2-yl)methylidene]indene-1,3-dione |
|---|---|
| PubChem CID | 168736132 |
| Molecular Formula | C21H9F2NO3S |
| Molecular Weight | 393.37 g/mol |
| Exact Mass | 393.03 |
| IUPAC Name | 4,7-difluoro-2-[(5-phenylthieno[2,3-d][1,3]oxazol-2-yl)methylidene]indene-1,3-dione |
| SMILES | O=C1C(=Cc2nc3sc(-c4ccccc4)cc3o2)C(=O)c2c(F)ccc(F)c21 |
| InChI | InChI=1S/C21H9F2NO3S/c22-12-6-7-13(23)18-17(12)19(25)11(20(18)26)8-16-24-21-14(27-16)9-15(28-21)10-4-2-1-3-5-10/h1-9H |
| InChIKey | AGWUYFSQEOMOLY-UHFFFAOYSA-N |
| XLogP | 5.30 |
| TPSA | 60.17 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.37 |
| LogP ≤ 5 | 5.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'ene_five_one_A(55)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|