C20H10N2O4S — CID 168736362
(3Z)-3-[(2-phenyl-[1,3]thiazolo[5,4-d][1,3]oxazol-5-yl)methylidene]chromene-2,4-dione (PubChem CID 168736362) has the molecular formula C20H10N2O4S and a molecular weight of 374.38 g/mol. Its IUPAC name is (3Z)-3-[(2-phenyl-[1,3]thiazolo[5,4-d][1,3]oxazol-5-yl)methylidene]chromene-2,4-dione.
| Compound Name | (3Z)-3-[(2-phenyl-[1,3]thiazolo[5,4-d][1,3]oxazol-5-yl)methylidene]chromene-2,4-dione |
|---|---|
| PubChem CID | 168736362 |
| Molecular Formula | C20H10N2O4S |
| Molecular Weight | 374.38 g/mol |
| Exact Mass | 374.04 |
| IUPAC Name | (3Z)-3-[(2-phenyl-[1,3]thiazolo[5,4-d][1,3]oxazol-5-yl)methylidene]chromene-2,4-dione |
| SMILES | O=C1Oc2ccccc2C(=O)/C1=C/c1nc2oc(-c3ccccc3)nc2s1 |
| InChI | InChI=1S/C20H10N2O4S/c23-16-12-8-4-5-9-14(12)25-20(24)13(16)10-15-21-18-19(27-15)22-17(26-18)11-6-2-1-3-7-11/h1-10H/b13-10- |
| InChIKey | HRWWMJMUYXFPGE-RAXLEYEMSA-N |
| XLogP | 4.14 |
| TPSA | 82.29 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.38 |
| LogP ≤ 5 | 4.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|