C23H16N8O6S — CID 16873696
4-methyl-3,5-dinitro-N-[4-(3-pyridin-3-yl-[1,2,4]triazolo[4,3-b]pyridazin-6-yl)phenyl]benzenesulfonamide (PubChem CID 16873696) has the molecular formula C23H16N8O6S and a molecular weight of 532.50 g/mol. Its IUPAC name is 4-methyl-3,5-dinitro-N-[4-(3-pyridin-3-yl-[1,2,4]triazolo[4,3-b]pyridazin-6-yl)phenyl]benzenesulfonamide.
| Compound Name | 4-methyl-3,5-dinitro-N-[4-(3-pyridin-3-yl-[1,2,4]triazolo[4,3-b]pyridazin-6-yl)phenyl]benzenesulfonamide |
|---|---|
| PubChem CID | 16873696 |
| Molecular Formula | C23H16N8O6S |
| Molecular Weight | 532.50 g/mol |
| Exact Mass | 532.09 |
| IUPAC Name | 4-methyl-3,5-dinitro-N-[4-(3-pyridin-3-yl-[1,2,4]triazolo[4,3-b]pyridazin-6-yl)phenyl]benzenesulfonamide |
| SMILES | Cc1c([N+](=O)[O-])cc(S(=O)(=O)Nc2ccc(-c3ccc4nnc(-c5cccnc5)n4n3)cc2)cc1[N+](=O)[O-] |
| InChI | InChI=1S/C23H16N8O6S/c1-14-20(30(32)33)11-18(12-21(14)31(34)35)38(36,37)28-17-6-4-15(5-7-17)19-8-9-22-25-26-23(29(22)27-19)16-3-2-10-24-13-16/h2-13,28H,1H3 |
| InChIKey | NUQJQNMSCYKFPM-UHFFFAOYSA-N |
| XLogP | 3.78 |
| TPSA | 188.42 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 532.50 |
| LogP ≤ 5 | 3.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|