C29H33ClN4O3 — CID 168737201
4-[(2S,4R)-1-acetyl-4-(4-chloroanilino)-2-methyl-3,4-dihydro-2H-quinolin-6-yl]-N-[2-(2-aminoethoxy)ethyl]benzamide (PubChem CID 168737201) has the molecular formula C29H33ClN4O3 and a molecular weight of 521.06 g/mol. Its IUPAC name is 4-[(2S,4R)-1-acetyl-4-(4-chloroanilino)-2-methyl-3,4-dihydro-2H-quinolin-6-yl]-N-[2-(2-aminoethoxy)ethyl]benzamide.
| Compound Name | 4-[(2S,4R)-1-acetyl-4-(4-chloroanilino)-2-methyl-3,4-dihydro-2H-quinolin-6-yl]-N-[2-(2-aminoethoxy)ethyl]benzamide |
|---|---|
| PubChem CID | 168737201 |
| Molecular Formula | C29H33ClN4O3 |
| Molecular Weight | 521.06 g/mol |
| Exact Mass | 520.22 |
| IUPAC Name | 4-[(2S,4R)-1-acetyl-4-(4-chloroanilino)-2-methyl-3,4-dihydro-2H-quinolin-6-yl]-N-[2-(2-aminoethoxy)ethyl]benzamide |
| SMILES | CC(=O)N1c2ccc(-c3ccc(C(=O)NCCOCCN)cc3)cc2[C@H](Nc2ccc(Cl)cc2)C[C@@H]1C |
| InChI | InChI=1S/C29H33ClN4O3/c1-19-17-27(33-25-10-8-24(30)9-11-25)26-18-23(7-12-28(26)34(19)20(2)35)21-3-5-22(6-4-21)29(36)32-14-16-37-15-13-31/h3-12,18-19,27,33H,13-17,31H2,1-2H3,(H,32,36)/t19-,27+/m0/s1 |
| InChIKey | ANGMXBSYZWMVLD-UZTOHYMASA-N |
| XLogP | 5.01 |
| TPSA | 96.69 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 521.06 |
| LogP ≤ 5 | 5.01 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|