C26H24N6O3S — CID 16873741
4-butoxy-N-[3-(3-pyridin-4-yl-[1,2,4]triazolo[4,3-b]pyridazin-6-yl)phenyl]benzenesulfonamide (PubChem CID 16873741) has the molecular formula C26H24N6O3S and a molecular weight of 500.58 g/mol. Its IUPAC name is 4-butoxy-N-[3-(3-pyridin-4-yl-[1,2,4]triazolo[4,3-b]pyridazin-6-yl)phenyl]benzenesulfonamide.
| Compound Name | 4-butoxy-N-[3-(3-pyridin-4-yl-[1,2,4]triazolo[4,3-b]pyridazin-6-yl)phenyl]benzenesulfonamide |
|---|---|
| PubChem CID | 16873741 |
| Molecular Formula | C26H24N6O3S |
| Molecular Weight | 500.58 g/mol |
| Exact Mass | 500.16 |
| IUPAC Name | 4-butoxy-N-[3-(3-pyridin-4-yl-[1,2,4]triazolo[4,3-b]pyridazin-6-yl)phenyl]benzenesulfonamide |
| SMILES | CCCCOc1ccc(S(=O)(=O)Nc2cccc(-c3ccc4nnc(-c5ccncc5)n4n3)c2)cc1 |
| InChI | InChI=1S/C26H24N6O3S/c1-2-3-17-35-22-7-9-23(10-8-22)36(33,34)31-21-6-4-5-20(18-21)24-11-12-25-28-29-26(32(25)30-24)19-13-15-27-16-14-19/h4-16,18,31H,2-3,17H2,1H3 |
| InChIKey | NPGVBJZUMXJCRE-UHFFFAOYSA-N |
| XLogP | 4.83 |
| TPSA | 111.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 500.58 |
| LogP ≤ 5 | 4.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|