C7H11F2NO3 — CID 168737415
(2S,4R)-4-(2,2-difluoroethoxy)pyrrolidine-2-carboxylic acid (PubChem CID 168737415) has the molecular formula C7H11F2NO3 and a molecular weight of 195.16 g/mol. Its IUPAC name is (2S,4R)-4-(2,2-difluoroethoxy)pyrrolidine-2-carboxylic acid.
| Compound Name | (2S,4R)-4-(2,2-difluoroethoxy)pyrrolidine-2-carboxylic acid |
|---|---|
| PubChem CID | 168737415 |
| Molecular Formula | C7H11F2NO3 |
| Molecular Weight | 195.16 g/mol |
| Exact Mass | 195.07 |
| IUPAC Name | (2S,4R)-4-(2,2-difluoroethoxy)pyrrolidine-2-carboxylic acid |
| SMILES | O=C(O)[C@@H]1C[C@@H](OCC(F)F)CN1 |
| InChI | InChI=1S/C7H11F2NO3/c8-6(9)3-13-4-1-5(7(11)12)10-2-4/h4-6,10H,1-3H2,(H,11,12)/t4-,5+/m1/s1 |
| InChIKey | YDFBQMPWUIQSBZ-UHNVWZDZSA-N |
| XLogP | 0.08 |
| TPSA | 58.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 195.16 |
| LogP ≤ 5 | 0.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |