(2S,4R)-4-(2,2-difluoroethoxy)pyrrolidine-2-carboxylic acid

C7H11F2NO3 — CID 168737415

IUPAC(2S,4R)-4-(2,2-difluoroethoxy)pyrrolidine-2-carboxylic acid
SMILESO=C(O)[C@@H]1C[C@@H](OCC(F)F)CN1
InChIInChI=1S/C7H11F2NO3/c8-6(9)3-13-4-1-5(7(11)12)10-2-4/h4-6,10H,1-3H2,(H,11,12)/t4-,5+/m1/s1
InChIKeyYDFBQMPWUIQSBZ-UHNVWZDZSA-N
MW195.16 g/mol
LogP0.08
Rot. Bonds4

About (2S,4R)-4-(2,2-difluoroethoxy)pyrrolidine-2-carboxylic acid

(2S,4R)-4-(2,2-difluoroethoxy)pyrrolidine-2-carboxylic acid (PubChem CID 168737415) has the molecular formula C7H11F2NO3 and a molecular weight of 195.16 g/mol. Its IUPAC name is (2S,4R)-4-(2,2-difluoroethoxy)pyrrolidine-2-carboxylic acid.

Molecular Properties

Compound Name(2S,4R)-4-(2,2-difluoroethoxy)pyrrolidine-2-carboxylic acid
PubChem CID168737415
Molecular FormulaC7H11F2NO3
Molecular Weight195.16 g/mol
Exact Mass195.07
IUPAC Name(2S,4R)-4-(2,2-difluoroethoxy)pyrrolidine-2-carboxylic acid
SMILESO=C(O)[C@@H]1C[C@@H](OCC(F)F)CN1
InChIInChI=1S/C7H11F2NO3/c8-6(9)3-13-4-1-5(7(11)12)10-2-4/h4-6,10H,1-3H2,(H,11,12)/t4-,5+/m1/s1
InChIKeyYDFBQMPWUIQSBZ-UHNVWZDZSA-N
XLogP0.08
TPSA58.56 Ų
H-Bond Donors2
H-Bond Acceptors3
Rotatable Bonds4
Heavy Atoms13
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500195.16
LogP ≤ 50.08
H-Bond Donors ≤ 52
H-Bond Acceptors ≤ 103

Analyze (2S,4R)-4-(2,2-difluoroethoxy)pyrrolidine-2-carboxylic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of (2S,4R)-4-(2,2-difluoroethoxy)pyrrolidine-2-carboxylic acid?
The IUPAC name of (2S,4R)-4-(2,2-difluoroethoxy)pyrrolidine-2-carboxylic acid (CID 168737415) is (2S,4R)-4-(2,2-difluoroethoxy)pyrrolidine-2-carboxylic acid.
What is the SMILES notation for (2S,4R)-4-(2,2-difluoroethoxy)pyrrolidine-2-carboxylic acid?
The canonical SMILES for (2S,4R)-4-(2,2-difluoroethoxy)pyrrolidine-2-carboxylic acid is O=C(O)[C@@H]1C[C@@H](OCC(F)F)CN1.
What is the InChIKey of (2S,4R)-4-(2,2-difluoroethoxy)pyrrolidine-2-carboxylic acid?
The InChIKey is YDFBQMPWUIQSBZ-UHNVWZDZSA-N. The full InChI is InChI=1S/C7H11F2NO3/c8-6(9)3-13-4-1-5(7(11)12)10-2-4/h4-6,10H,1-3H2,(H,11,12)/t4-,5+/m1/s1.
What are the key properties of (2S,4R)-4-(2,2-difluoroethoxy)pyrrolidine-2-carboxylic acid?
(2S,4R)-4-(2,2-difluoroethoxy)pyrrolidine-2-carboxylic acid has a molecular weight of 195.16 g/mol, XLogP of 0.08, 4 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (2S,4R)-4-(2,2-difluoroethoxy)pyrrolidine-2-carboxylic acid is sourced from PubChem (CID 168737415), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).