About 6-bromo-4-(isocyanomethyl)-4-methyl-1,3-dihydroisochromene
6-bromo-4-(isocyanomethyl)-4-methyl-1,3-dihydroisochromene (PubChem CID 168737762) has the molecular formula C12H12BrNO
and a molecular weight of 266.14 g/mol. Its IUPAC name is 6-bromo-4-(isocyanomethyl)-4-methyl-1,3-dihydroisochromene.
Molecular Properties
| Compound Name | 6-bromo-4-(isocyanomethyl)-4-methyl-1,3-dihydroisochromene |
| PubChem CID | 168737762 |
| Molecular Formula | C12H12BrNO |
| Molecular Weight | 266.14 g/mol |
| Exact Mass | 265.01 |
| IUPAC Name | 6-bromo-4-(isocyanomethyl)-4-methyl-1,3-dihydroisochromene |
| SMILES | [C-]#[N+]CC1(C)COCc2ccc(Br)cc21 |
| InChI | InChI=1S/C12H12BrNO/c1-12(7-14-2)8-15-6-9-3-4-10(13)5-11(9)12/h3-5H,6-8H2,1H3 |
| InChIKey | FODKWGPHVQECJH-UHFFFAOYSA-N |
| XLogP | 3.16 |
| TPSA | 13.59 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 266.14 |
| LogP ≤ 5 | 3.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|
Analyze 6-bromo-4-(isocyanomethyl)-4-methyl-1,3-dihydroisochromene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-bromo-4-(isocyanomethyl)-4-methyl-1,3-dihydroisochromene?
The IUPAC name of 6-bromo-4-(isocyanomethyl)-4-methyl-1,3-dihydroisochromene (CID 168737762) is 6-bromo-4-(isocyanomethyl)-4-methyl-1,3-dihydroisochromene.
What is the SMILES notation for 6-bromo-4-(isocyanomethyl)-4-methyl-1,3-dihydroisochromene?
The canonical SMILES for 6-bromo-4-(isocyanomethyl)-4-methyl-1,3-dihydroisochromene is [C-]#[N+]CC1(C)COCc2ccc(Br)cc21.
What is the InChIKey of 6-bromo-4-(isocyanomethyl)-4-methyl-1,3-dihydroisochromene?
The InChIKey is FODKWGPHVQECJH-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H12BrNO/c1-12(7-14-2)8-15-6-9-3-4-10(13)5-11(9)12/h3-5H,6-8H2,1H3.
What are the key properties of 6-bromo-4-(isocyanomethyl)-4-methyl-1,3-dihydroisochromene?
6-bromo-4-(isocyanomethyl)-4-methyl-1,3-dihydroisochromene has a molecular weight of 266.14 g/mol, XLogP of 3.16, 1 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 6-bromo-4-(isocyanomethyl)-4-methyl-1,3-dihydroisochromene is sourced from PubChem (CID 168737762), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).