About 1-bromo-3-[3,3-difluoro-3-(4-fluorophenyl)prop-1-enyl]benzene
1-bromo-3-[3,3-difluoro-3-(4-fluorophenyl)prop-1-enyl]benzene (PubChem CID 168738433) has the molecular formula C15H10BrF3
and a molecular weight of 327.14 g/mol. Its IUPAC name is 1-bromo-3-[3,3-difluoro-3-(4-fluorophenyl)prop-1-enyl]benzene.
Molecular Properties
| Compound Name | 1-bromo-3-[3,3-difluoro-3-(4-fluorophenyl)prop-1-enyl]benzene |
| PubChem CID | 168738433 |
| Molecular Formula | C15H10BrF3 |
| Molecular Weight | 327.14 g/mol |
| Exact Mass | 325.99 |
| IUPAC Name | 1-bromo-3-[3,3-difluoro-3-(4-fluorophenyl)prop-1-enyl]benzene |
| SMILES | Fc1ccc(C(F)(F)C=Cc2cccc(Br)c2)cc1 |
| InChI | InChI=1S/C15H10BrF3/c16-13-3-1-2-11(10-13)8-9-15(18,19)12-4-6-14(17)7-5-12/h1-10H |
| InChIKey | ZUGYBVRPOVJKMP-UHFFFAOYSA-N |
| XLogP | 5.39 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 327.14 |
| LogP ≤ 5 | 5.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Analyze 1-bromo-3-[3,3-difluoro-3-(4-fluorophenyl)prop-1-enyl]benzene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-bromo-3-[3,3-difluoro-3-(4-fluorophenyl)prop-1-enyl]benzene?
The IUPAC name of 1-bromo-3-[3,3-difluoro-3-(4-fluorophenyl)prop-1-enyl]benzene (CID 168738433) is 1-bromo-3-[3,3-difluoro-3-(4-fluorophenyl)prop-1-enyl]benzene.
What is the SMILES notation for 1-bromo-3-[3,3-difluoro-3-(4-fluorophenyl)prop-1-enyl]benzene?
The canonical SMILES for 1-bromo-3-[3,3-difluoro-3-(4-fluorophenyl)prop-1-enyl]benzene is Fc1ccc(C(F)(F)C=Cc2cccc(Br)c2)cc1.
What is the InChIKey of 1-bromo-3-[3,3-difluoro-3-(4-fluorophenyl)prop-1-enyl]benzene?
The InChIKey is ZUGYBVRPOVJKMP-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H10BrF3/c16-13-3-1-2-11(10-13)8-9-15(18,19)12-4-6-14(17)7-5-12/h1-10H.
What are the key properties of 1-bromo-3-[3,3-difluoro-3-(4-fluorophenyl)prop-1-enyl]benzene?
1-bromo-3-[3,3-difluoro-3-(4-fluorophenyl)prop-1-enyl]benzene has a molecular weight of 327.14 g/mol, XLogP of 5.39, 3 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 1-bromo-3-[3,3-difluoro-3-(4-fluorophenyl)prop-1-enyl]benzene is sourced from PubChem (CID 168738433), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).