C39H23N3OSe — CID 168739820
7-(4-dibenzofuran-1-yl-6-phenylpyrimidin-2-yl)-2-phenylbenzo[g][1,3]benzoselenazole (PubChem CID 168739820) has the molecular formula C39H23N3OSe and a molecular weight of 628.59 g/mol. Its IUPAC name is 7-(4-dibenzofuran-1-yl-6-phenylpyrimidin-2-yl)-2-phenylbenzo[g][1,3]benzoselenazole.
| Compound Name | 7-(4-dibenzofuran-1-yl-6-phenylpyrimidin-2-yl)-2-phenylbenzo[g][1,3]benzoselenazole |
|---|---|
| PubChem CID | 168739820 |
| Molecular Formula | C39H23N3OSe |
| Molecular Weight | 628.59 g/mol |
| Exact Mass | 629.10 |
| IUPAC Name | 7-(4-dibenzofuran-1-yl-6-phenylpyrimidin-2-yl)-2-phenylbenzo[g][1,3]benzoselenazole |
| SMILES | c1ccc(-c2cc(-c3cccc4oc5ccccc5c34)nc(-c3ccc4c(ccc5nc(-c6ccccc6)[se]c54)c3)n2)cc1 |
| InChI | InChI=1S/C39H23N3OSe/c1-3-10-24(11-4-1)32-23-33(29-15-9-17-35-36(29)30-14-7-8-16-34(30)43-35)41-38(40-32)27-18-20-28-26(22-27)19-21-31-37(28)44-39(42-31)25-12-5-2-6-13-25/h1-23H |
| InChIKey | IBFPUWLSIGJJEI-UHFFFAOYSA-N |
| XLogP | 9.80 |
| TPSA | 51.81 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 628.59 |
| LogP ≤ 5 | 9.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|