C45H37N3O — CID 168740154
2-cyclohexa-2,4-dien-1-yl-4-[(8R)-8-(cyclohexen-1-yl)-8,9-dihydrodibenzofuran-4-yl]-6-(1,2-dihydrochrysen-3-yl)-1,3,5-triazine (PubChem CID 168740154) has the molecular formula C45H37N3O and a molecular weight of 635.81 g/mol. Its IUPAC name is 2-cyclohexa-2,4-dien-1-yl-4-[(8R)-8-(cyclohexen-1-yl)-8,9-dihydrodibenzofuran-4-yl]-6-(1,2-dihydrochrysen-3-yl)-1,3,5-triazine.
| Compound Name | 2-cyclohexa-2,4-dien-1-yl-4-[(8R)-8-(cyclohexen-1-yl)-8,9-dihydrodibenzofuran-4-yl]-6-(1,2-dihydrochrysen-3-yl)-1,3,5-triazine |
|---|---|
| PubChem CID | 168740154 |
| Molecular Formula | C45H37N3O |
| Molecular Weight | 635.81 g/mol |
| Exact Mass | 635.29 |
| IUPAC Name | 2-cyclohexa-2,4-dien-1-yl-4-[(8R)-8-(cyclohexen-1-yl)-8,9-dihydrodibenzofuran-4-yl]-6-(1,2-dihydrochrysen-3-yl)-1,3,5-triazine |
| SMILES | C1=CCC(c2nc(C3=Cc4c(ccc5c4ccc4ccccc45)CC3)nc(-c3cccc4c5c(oc34)C=C[C@H](C3=CCCCC3)C5)n2)C=C1 |
| InChI | InChI=1S/C45H37N3O/c1-3-10-28(11-4-1)32-22-25-41-40(26-32)37-16-9-17-38(42(37)49-41)45-47-43(31-13-5-2-6-14-31)46-44(48-45)33-19-18-30-21-23-35-34-15-8-7-12-29(34)20-24-36(35)39(30)27-33/h2,5-10,12-13,15-17,20-25,27,31-32H,1,3-4,11,14,18-19,26H2/t31?,32-/m0/s1 |
| InChIKey | OKYJCHCRPXAAMX-JYUUXGOASA-N |
| XLogP | 11.36 |
| TPSA | 51.81 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 49 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 635.81 |
| LogP ≤ 5 | 11.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|