C17H16S3 — CID 168740471
5,13,17-trithiatetracyclo[7.7.2.13,15.17,11]icosa-1(16),2,7,9,11(20),15(19)-hexaene (PubChem CID 168740471) has the molecular formula C17H16S3 and a molecular weight of 316.52 g/mol. Its IUPAC name is 5,13,17-trithiatetracyclo[7.7.2.13,15.17,11]icosa-1(16),2,7,9,11(20),15(19)-hexaene.
| Compound Name | 5,13,17-trithiatetracyclo[7.7.2.13,15.17,11]icosa-1(16),2,7,9,11(20),15(19)-hexaene |
|---|---|
| PubChem CID | 168740471 |
| Molecular Formula | C17H16S3 |
| Molecular Weight | 316.52 g/mol |
| Exact Mass | 316.04 |
| IUPAC Name | 5,13,17-trithiatetracyclo[7.7.2.13,15.17,11]icosa-1(16),2,7,9,11(20),15(19)-hexaene |
| SMILES | c1c2cc3cc1CSCc1cc(cc(c1)SC3)CSC2 |
| InChI | InChI=1S/C17H16S3/c1-12-2-14-3-13(1)8-19-10-16-4-15(9-18-7-12)5-17(6-16)20-11-14/h1-6H,7-11H2 |
| InChIKey | TUSFUCZNVZUJRS-UHFFFAOYSA-N |
| XLogP | 5.47 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.52 |
| LogP ≤ 5 | 5.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |