About ethyl N-[6-(1,4-diazabicyclo[2.2.2]octan-2-ylmethoxycarbonylamino)hexyl]carbamate
ethyl N-[6-(1,4-diazabicyclo[2.2.2]octan-2-ylmethoxycarbonylamino)hexyl]carbamate (PubChem CID 168740882) has the molecular formula C17H32N4O4
and a molecular weight of 356.47 g/mol. Its IUPAC name is ethyl N-[6-(1,4-diazabicyclo[2.2.2]octan-2-ylmethoxycarbonylamino)hexyl]carbamate.
Molecular Properties
| Compound Name | ethyl N-[6-(1,4-diazabicyclo[2.2.2]octan-2-ylmethoxycarbonylamino)hexyl]carbamate |
| PubChem CID | 168740882 |
| Molecular Formula | C17H32N4O4 |
| Molecular Weight | 356.47 g/mol |
| Exact Mass | 356.24 |
| IUPAC Name | ethyl N-[6-(1,4-diazabicyclo[2.2.2]octan-2-ylmethoxycarbonylamino)hexyl]carbamate |
| SMILES | CCOC(=O)NCCCCCCNC(=O)OCC1CN2CCN1CC2 |
| InChI | InChI=1S/C17H32N4O4/c1-2-24-16(22)18-7-5-3-4-6-8-19-17(23)25-14-15-13-20-9-11-21(15)12-10-20/h15H,2-14H2,1H3,(H,18,22)(H,19,23) |
| InChIKey | SRLGVGOHNBTCEK-UHFFFAOYSA-N |
| XLogP | 1.02 |
| TPSA | 83.14 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 356.47 |
| LogP ≤ 5 | 1.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze ethyl N-[6-(1,4-diazabicyclo[2.2.2]octan-2-ylmethoxycarbonylamino)hexyl]carbamate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethyl N-[6-(1,4-diazabicyclo[2.2.2]octan-2-ylmethoxycarbonylamino)hexyl]carbamate?
The IUPAC name of ethyl N-[6-(1,4-diazabicyclo[2.2.2]octan-2-ylmethoxycarbonylamino)hexyl]carbamate (CID 168740882) is ethyl N-[6-(1,4-diazabicyclo[2.2.2]octan-2-ylmethoxycarbonylamino)hexyl]carbamate.
What is the SMILES notation for ethyl N-[6-(1,4-diazabicyclo[2.2.2]octan-2-ylmethoxycarbonylamino)hexyl]carbamate?
The canonical SMILES for ethyl N-[6-(1,4-diazabicyclo[2.2.2]octan-2-ylmethoxycarbonylamino)hexyl]carbamate is CCOC(=O)NCCCCCCNC(=O)OCC1CN2CCN1CC2.
What is the InChIKey of ethyl N-[6-(1,4-diazabicyclo[2.2.2]octan-2-ylmethoxycarbonylamino)hexyl]carbamate?
The InChIKey is SRLGVGOHNBTCEK-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H32N4O4/c1-2-24-16(22)18-7-5-3-4-6-8-19-17(23)25-14-15-13-20-9-11-21(15)12-10-20/h15H,2-14H2,1H3,(H,18,22)(H,19,23).
What are the key properties of ethyl N-[6-(1,4-diazabicyclo[2.2.2]octan-2-ylmethoxycarbonylamino)hexyl]carbamate?
ethyl N-[6-(1,4-diazabicyclo[2.2.2]octan-2-ylmethoxycarbonylamino)hexyl]carbamate has a molecular weight of 356.47 g/mol, XLogP of 1.02, 10 rotatable bonds, 2 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for ethyl N-[6-(1,4-diazabicyclo[2.2.2]octan-2-ylmethoxycarbonylamino)hexyl]carbamate is sourced from PubChem (CID 168740882), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).