About 5-(4-methyl-1,3,5-triazin-2-yl)benzene-1,3-diol
5-(4-methyl-1,3,5-triazin-2-yl)benzene-1,3-diol (PubChem CID 168740997) has the molecular formula C10H9N3O2
and a molecular weight of 203.20 g/mol. Its IUPAC name is 5-(4-methyl-1,3,5-triazin-2-yl)benzene-1,3-diol.
Molecular Properties
| Compound Name | 5-(4-methyl-1,3,5-triazin-2-yl)benzene-1,3-diol |
| PubChem CID | 168740997 |
| Molecular Formula | C10H9N3O2 |
| Molecular Weight | 203.20 g/mol |
| Exact Mass | 203.07 |
| IUPAC Name | 5-(4-methyl-1,3,5-triazin-2-yl)benzene-1,3-diol |
| SMILES | Cc1ncnc(-c2cc(O)cc(O)c2)n1 |
| InChI | InChI=1S/C10H9N3O2/c1-6-11-5-12-10(13-6)7-2-8(14)4-9(15)3-7/h2-5,14-15H,1H3 |
| InChIKey | AINWDBZOSDJITC-UHFFFAOYSA-N |
| XLogP | 1.26 |
| TPSA | 79.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 203.20 |
| LogP ≤ 5 | 1.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 5-(4-methyl-1,3,5-triazin-2-yl)benzene-1,3-diol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-(4-methyl-1,3,5-triazin-2-yl)benzene-1,3-diol?
The IUPAC name of 5-(4-methyl-1,3,5-triazin-2-yl)benzene-1,3-diol (CID 168740997) is 5-(4-methyl-1,3,5-triazin-2-yl)benzene-1,3-diol.
What is the SMILES notation for 5-(4-methyl-1,3,5-triazin-2-yl)benzene-1,3-diol?
The canonical SMILES for 5-(4-methyl-1,3,5-triazin-2-yl)benzene-1,3-diol is Cc1ncnc(-c2cc(O)cc(O)c2)n1.
What is the InChIKey of 5-(4-methyl-1,3,5-triazin-2-yl)benzene-1,3-diol?
The InChIKey is AINWDBZOSDJITC-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H9N3O2/c1-6-11-5-12-10(13-6)7-2-8(14)4-9(15)3-7/h2-5,14-15H,1H3.
What are the key properties of 5-(4-methyl-1,3,5-triazin-2-yl)benzene-1,3-diol?
5-(4-methyl-1,3,5-triazin-2-yl)benzene-1,3-diol has a molecular weight of 203.20 g/mol, XLogP of 1.26, 1 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 5-(4-methyl-1,3,5-triazin-2-yl)benzene-1,3-diol is sourced from PubChem (CID 168740997), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).