C14H22ClN3O3 — CID 168741293
methyl (2S)-2-amino-5-[methyl(2-pyridin-4-ylethyl)amino]-5-oxopentanoate;hydrochloride (PubChem CID 168741293) has the molecular formula C14H22ClN3O3 and a molecular weight of 315.80 g/mol. Its IUPAC name is methyl (2S)-2-amino-5-[methyl(2-pyridin-4-ylethyl)amino]-5-oxopentanoate;hydrochloride.
| Compound Name | methyl (2S)-2-amino-5-[methyl(2-pyridin-4-ylethyl)amino]-5-oxopentanoate;hydrochloride |
|---|---|
| PubChem CID | 168741293 |
| Molecular Formula | C14H22ClN3O3 |
| Molecular Weight | 315.80 g/mol |
| Exact Mass | 315.13 |
| IUPAC Name | methyl (2S)-2-amino-5-[methyl(2-pyridin-4-ylethyl)amino]-5-oxopentanoate;hydrochloride |
| SMILES | COC(=O)[C@@H](N)CCC(=O)N(C)CCc1ccncc1.Cl |
| InChI | InChI=1S/C14H21N3O3.ClH/c1-17(10-7-11-5-8-16-9-6-11)13(18)4-3-12(15)14(19)20-2;/h5-6,8-9,12H,3-4,7,10,15H2,1-2H3;1H/t12-;/m0./s1 |
| InChIKey | RCUYMEQEHVBNAD-YDALLXLXSA-N |
| XLogP | 0.78 |
| TPSA | 85.52 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.80 |
| LogP ≤ 5 | 0.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |