About (2-aminoanilino) acetate
(2-aminoanilino) acetate (PubChem CID 168742101) has the molecular formula C8H10N2O2
and a molecular weight of 166.18 g/mol. Its IUPAC name is (2-aminoanilino) acetate.
Molecular Properties
| Compound Name | (2-aminoanilino) acetate |
| PubChem CID | 168742101 |
| Molecular Formula | C8H10N2O2 |
| Molecular Weight | 166.18 g/mol |
| Exact Mass | 166.07 |
| IUPAC Name | (2-aminoanilino) acetate |
| SMILES | CC(=O)ONc1ccccc1N |
| InChI | InChI=1S/C8H10N2O2/c1-6(11)12-10-8-5-3-2-4-7(8)9/h2-5,10H,9H2,1H3 |
| InChIKey | SPLBUXJDABNMFH-UHFFFAOYSA-N |
| XLogP | 1.16 |
| TPSA | 64.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 166.18 |
| LogP ≤ 5 | 1.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze (2-aminoanilino) acetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2-aminoanilino) acetate?
The IUPAC name of (2-aminoanilino) acetate (CID 168742101) is (2-aminoanilino) acetate.
What is the SMILES notation for (2-aminoanilino) acetate?
The canonical SMILES for (2-aminoanilino) acetate is CC(=O)ONc1ccccc1N.
What is the InChIKey of (2-aminoanilino) acetate?
The InChIKey is SPLBUXJDABNMFH-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H10N2O2/c1-6(11)12-10-8-5-3-2-4-7(8)9/h2-5,10H,9H2,1H3.
What are the key properties of (2-aminoanilino) acetate?
(2-aminoanilino) acetate has a molecular weight of 166.18 g/mol, XLogP of 1.16, 2 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for (2-aminoanilino) acetate is sourced from PubChem (CID 168742101), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).