C18H29N3O3 — CID 168742136
2-(1,5-dimethylpyrrolidin-2-yl)-N-[2-methoxy-1-[(3-methyl-2-pyridinyl)oxy]propan-2-yl]acetamide (PubChem CID 168742136) has the molecular formula C18H29N3O3 and a molecular weight of 335.45 g/mol. Its IUPAC name is 2-(1,5-dimethylpyrrolidin-2-yl)-N-[2-methoxy-1-[(3-methyl-2-pyridinyl)oxy]propan-2-yl]acetamide.
| Compound Name | 2-(1,5-dimethylpyrrolidin-2-yl)-N-[2-methoxy-1-[(3-methyl-2-pyridinyl)oxy]propan-2-yl]acetamide |
|---|---|
| PubChem CID | 168742136 |
| Molecular Formula | C18H29N3O3 |
| Molecular Weight | 335.45 g/mol |
| Exact Mass | 335.22 |
| IUPAC Name | 2-(1,5-dimethylpyrrolidin-2-yl)-N-[2-methoxy-1-[(3-methyl-2-pyridinyl)oxy]propan-2-yl]acetamide |
| SMILES | COC(C)(COc1ncccc1C)NC(=O)CC1CCC(C)N1C |
| InChI | InChI=1S/C18H29N3O3/c1-13-7-6-10-19-17(13)24-12-18(3,23-5)20-16(22)11-15-9-8-14(2)21(15)4/h6-7,10,14-15H,8-9,11-12H2,1-5H3,(H,20,22) |
| InChIKey | YAONUNJGUSJSSL-UHFFFAOYSA-N |
| XLogP | 2.12 |
| TPSA | 63.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.45 |
| LogP ≤ 5 | 2.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|