About N-tert-butyl-N'-(1,1,1-trifluoropropan-2-yl)butanimidamide
N-tert-butyl-N'-(1,1,1-trifluoropropan-2-yl)butanimidamide (PubChem CID 168742261) has the molecular formula C11H21F3N2
and a molecular weight of 238.30 g/mol. Its IUPAC name is N-tert-butyl-N'-(1,1,1-trifluoropropan-2-yl)butanimidamide.
Molecular Properties
| Compound Name | N-tert-butyl-N'-(1,1,1-trifluoropropan-2-yl)butanimidamide |
| PubChem CID | 168742261 |
| Molecular Formula | C11H21F3N2 |
| Molecular Weight | 238.30 g/mol |
| Exact Mass | 238.17 |
| IUPAC Name | N-tert-butyl-N'-(1,1,1-trifluoropropan-2-yl)butanimidamide |
| SMILES | CCC/C(=N\C(C)C(F)(F)F)NC(C)(C)C |
| InChI | InChI=1S/C11H21F3N2/c1-6-7-9(16-10(3,4)5)15-8(2)11(12,13)14/h8H,6-7H2,1-5H3,(H,15,16) |
| InChIKey | YSIDWSXDVFXNLJ-UHFFFAOYSA-N |
| XLogP | 3.52 |
| TPSA | 24.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 238.30 |
| LogP ≤ 5 | 3.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|
Analyze N-tert-butyl-N'-(1,1,1-trifluoropropan-2-yl)butanimidamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-tert-butyl-N'-(1,1,1-trifluoropropan-2-yl)butanimidamide?
The IUPAC name of N-tert-butyl-N'-(1,1,1-trifluoropropan-2-yl)butanimidamide (CID 168742261) is N-tert-butyl-N'-(1,1,1-trifluoropropan-2-yl)butanimidamide.
What is the SMILES notation for N-tert-butyl-N'-(1,1,1-trifluoropropan-2-yl)butanimidamide?
The canonical SMILES for N-tert-butyl-N'-(1,1,1-trifluoropropan-2-yl)butanimidamide is CCC/C(=N\C(C)C(F)(F)F)NC(C)(C)C.
What is the InChIKey of N-tert-butyl-N'-(1,1,1-trifluoropropan-2-yl)butanimidamide?
The InChIKey is YSIDWSXDVFXNLJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H21F3N2/c1-6-7-9(16-10(3,4)5)15-8(2)11(12,13)14/h8H,6-7H2,1-5H3,(H,15,16).
What are the key properties of N-tert-butyl-N'-(1,1,1-trifluoropropan-2-yl)butanimidamide?
N-tert-butyl-N'-(1,1,1-trifluoropropan-2-yl)butanimidamide has a molecular weight of 238.30 g/mol, XLogP of 3.52, 3 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for N-tert-butyl-N'-(1,1,1-trifluoropropan-2-yl)butanimidamide is sourced from PubChem (CID 168742261), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).