About (N-tert-butyl-C-ethylcarbonimidoyl)-(2,2,2-trifluoroethyl)azanide;zinc
(N-tert-butyl-C-ethylcarbonimidoyl)-(2,2,2-trifluoroethyl)azanide;zinc (PubChem CID 168742270) has the molecular formula C9H16F3N2Zn-
and a molecular weight of 274.62 g/mol. Its IUPAC name is (N-tert-butyl-C-ethylcarbonimidoyl)-(2,2,2-trifluoroethyl)azanide;zinc.
Molecular Properties
| Compound Name | (N-tert-butyl-C-ethylcarbonimidoyl)-(2,2,2-trifluoroethyl)azanide;zinc |
| PubChem CID | 168742270 |
| Molecular Formula | C9H16F3N2Zn- |
| Molecular Weight | 274.62 g/mol |
| Exact Mass | 273.06 |
| IUPAC Name | (N-tert-butyl-C-ethylcarbonimidoyl)-(2,2,2-trifluoroethyl)azanide;zinc |
| SMILES | CC/C(=N\C(C)(C)C)[N-]CC(F)(F)F.[Zn] |
| InChI | InChI=1S/C9H16F3N2.Zn/c1-5-7(14-8(2,3)4)13-6-9(10,11)12;/h5-6H2,1-4H3;/q-1; |
| InChIKey | ILBRTRGSBJODAE-UHFFFAOYSA-N |
| XLogP | 3.53 |
| TPSA | 26.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 274.62 |
| LogP ≤ 5 | 3.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|
Analyze (N-tert-butyl-C-ethylcarbonimidoyl)-(2,2,2-trifluoroethyl)azanide;zinc with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (N-tert-butyl-C-ethylcarbonimidoyl)-(2,2,2-trifluoroethyl)azanide;zinc?
The IUPAC name of (N-tert-butyl-C-ethylcarbonimidoyl)-(2,2,2-trifluoroethyl)azanide;zinc (CID 168742270) is (N-tert-butyl-C-ethylcarbonimidoyl)-(2,2,2-trifluoroethyl)azanide;zinc.
What is the SMILES notation for (N-tert-butyl-C-ethylcarbonimidoyl)-(2,2,2-trifluoroethyl)azanide;zinc?
The canonical SMILES for (N-tert-butyl-C-ethylcarbonimidoyl)-(2,2,2-trifluoroethyl)azanide;zinc is CC/C(=N\C(C)(C)C)[N-]CC(F)(F)F.[Zn].
What is the InChIKey of (N-tert-butyl-C-ethylcarbonimidoyl)-(2,2,2-trifluoroethyl)azanide;zinc?
The InChIKey is ILBRTRGSBJODAE-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H16F3N2.Zn/c1-5-7(14-8(2,3)4)13-6-9(10,11)12;/h5-6H2,1-4H3;/q-1;.
What are the key properties of (N-tert-butyl-C-ethylcarbonimidoyl)-(2,2,2-trifluoroethyl)azanide;zinc?
(N-tert-butyl-C-ethylcarbonimidoyl)-(2,2,2-trifluoroethyl)azanide;zinc has a molecular weight of 274.62 g/mol, XLogP of 3.53, 2 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for (N-tert-butyl-C-ethylcarbonimidoyl)-(2,2,2-trifluoroethyl)azanide;zinc is sourced from PubChem (CID 168742270), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).