C41H24N6O — CID 168743066
9-(4-dibenzofuran-3-yl-6-phenyl-1,3,5-triazin-2-yl)-2-phenylnaphtho[1,2-e]benzotriazole (PubChem CID 168743066) has the molecular formula C41H24N6O and a molecular weight of 616.68 g/mol. Its IUPAC name is 9-(4-dibenzofuran-3-yl-6-phenyl-1,3,5-triazin-2-yl)-2-phenylnaphtho[1,2-e]benzotriazole.
| Compound Name | 9-(4-dibenzofuran-3-yl-6-phenyl-1,3,5-triazin-2-yl)-2-phenylnaphtho[1,2-e]benzotriazole |
|---|---|
| PubChem CID | 168743066 |
| Molecular Formula | C41H24N6O |
| Molecular Weight | 616.68 g/mol |
| Exact Mass | 616.20 |
| IUPAC Name | 9-(4-dibenzofuran-3-yl-6-phenyl-1,3,5-triazin-2-yl)-2-phenylnaphtho[1,2-e]benzotriazole |
| SMILES | c1ccc(-c2nc(-c3ccc4c(ccc5ccc6nn(-c7ccccc7)nc6c54)c3)nc(-c3ccc4c(c3)oc3ccccc34)n2)cc1 |
| InChI | InChI=1S/C41H24N6O/c1-3-9-26(10-4-1)39-42-40(44-41(43-39)29-18-21-33-32-13-7-8-14-35(32)48-36(33)24-29)28-17-20-31-27(23-28)16-15-25-19-22-34-38(37(25)31)46-47(45-34)30-11-5-2-6-12-30/h1-24H |
| InChIKey | RPPZQHUYVFAUMH-UHFFFAOYSA-N |
| XLogP | 9.81 |
| TPSA | 82.52 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 616.68 |
| LogP ≤ 5 | 9.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|