C54H39N5 — CID 168743071
9-[4,6-bis(9,9-dimethylfluoren-2-yl)pyrimidin-2-yl]-2-phenylnaphtho[1,2-e]benzotriazole (PubChem CID 168743071) has the molecular formula C54H39N5 and a molecular weight of 757.94 g/mol. Its IUPAC name is 9-[4,6-bis(9,9-dimethylfluoren-2-yl)pyrimidin-2-yl]-2-phenylnaphtho[1,2-e]benzotriazole.
| Compound Name | 9-[4,6-bis(9,9-dimethylfluoren-2-yl)pyrimidin-2-yl]-2-phenylnaphtho[1,2-e]benzotriazole |
|---|---|
| PubChem CID | 168743071 |
| Molecular Formula | C54H39N5 |
| Molecular Weight | 757.94 g/mol |
| Exact Mass | 757.32 |
| IUPAC Name | 9-[4,6-bis(9,9-dimethylfluoren-2-yl)pyrimidin-2-yl]-2-phenylnaphtho[1,2-e]benzotriazole |
| SMILES | CC1(C)c2ccccc2-c2ccc(-c3cc(-c4ccc5c(c4)C(C)(C)c4ccccc4-5)nc(-c4ccc5c(ccc6ccc7nn(-c8ccccc8)nc7c65)c4)n3)cc21 |
| InChI | InChI=1S/C54H39N5/c1-53(2)43-16-10-8-14-39(43)41-25-20-34(29-45(41)53)48-31-49(35-21-26-42-40-15-9-11-17-44(40)54(3,4)46(42)30-35)56-52(55-48)36-22-24-38-33(28-36)19-18-32-23-27-47-51(50(32)38)58-59(57-47)37-12-6-5-7-13-37/h5-31H,1-4H3 |
| InChIKey | QENKLFYFELRGFG-UHFFFAOYSA-N |
| XLogP | 13.13 |
| TPSA | 56.49 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 59 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 757.94 |
| LogP ≤ 5 | 13.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|