About ethyl 1-(3-bromophenyl)-4-(2,4-difluorophenyl)sulfonyloxy-6-oxopyridazine-3-carboxylate
ethyl 1-(3-bromophenyl)-4-(2,4-difluorophenyl)sulfonyloxy-6-oxopyridazine-3-carboxylate (PubChem CID 16874314) has the molecular formula C19H13BrF2N2O6S
and a molecular weight of 515.29 g/mol. Its IUPAC name is ethyl 1-(3-bromophenyl)-4-(2,4-difluorophenyl)sulfonyloxy-6-oxopyridazine-3-carboxylate.
Molecular Properties
| Compound Name | ethyl 1-(3-bromophenyl)-4-(2,4-difluorophenyl)sulfonyloxy-6-oxopyridazine-3-carboxylate |
| PubChem CID | 16874314 |
| Molecular Formula | C19H13BrF2N2O6S |
| Molecular Weight | 515.29 g/mol |
| Exact Mass | 513.96 |
| IUPAC Name | ethyl 1-(3-bromophenyl)-4-(2,4-difluorophenyl)sulfonyloxy-6-oxopyridazine-3-carboxylate |
| SMILES | CCOC(=O)c1nn(-c2cccc(Br)c2)c(=O)cc1OS(=O)(=O)c1ccc(F)cc1F |
| InChI | InChI=1S/C19H13BrF2N2O6S/c1-2-29-19(26)18-15(30-31(27,28)16-7-6-12(21)9-14(16)22)10-17(25)24(23-18)13-5-3-4-11(20)8-13/h3-10H,2H2,1H3 |
| InChIKey | RZZCMROVVZRMBA-UHFFFAOYSA-N |
| XLogP | 3.22 |
| TPSA | 104.56 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 515.29 |
| LogP ≤ 5 | 3.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|
Analyze ethyl 1-(3-bromophenyl)-4-(2,4-difluorophenyl)sulfonyloxy-6-oxopyridazine-3-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethyl 1-(3-bromophenyl)-4-(2,4-difluorophenyl)sulfonyloxy-6-oxopyridazine-3-carboxylate?
The IUPAC name of ethyl 1-(3-bromophenyl)-4-(2,4-difluorophenyl)sulfonyloxy-6-oxopyridazine-3-carboxylate (CID 16874314) is ethyl 1-(3-bromophenyl)-4-(2,4-difluorophenyl)sulfonyloxy-6-oxopyridazine-3-carboxylate.
What is the SMILES notation for ethyl 1-(3-bromophenyl)-4-(2,4-difluorophenyl)sulfonyloxy-6-oxopyridazine-3-carboxylate?
The canonical SMILES for ethyl 1-(3-bromophenyl)-4-(2,4-difluorophenyl)sulfonyloxy-6-oxopyridazine-3-carboxylate is CCOC(=O)c1nn(-c2cccc(Br)c2)c(=O)cc1OS(=O)(=O)c1ccc(F)cc1F.
What is the InChIKey of ethyl 1-(3-bromophenyl)-4-(2,4-difluorophenyl)sulfonyloxy-6-oxopyridazine-3-carboxylate?
The InChIKey is RZZCMROVVZRMBA-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H13BrF2N2O6S/c1-2-29-19(26)18-15(30-31(27,28)16-7-6-12(21)9-14(16)22)10-17(25)24(23-18)13-5-3-4-11(20)8-13/h3-10H,2H2,1H3.
What are the key properties of ethyl 1-(3-bromophenyl)-4-(2,4-difluorophenyl)sulfonyloxy-6-oxopyridazine-3-carboxylate?
ethyl 1-(3-bromophenyl)-4-(2,4-difluorophenyl)sulfonyloxy-6-oxopyridazine-3-carboxylate has a molecular weight of 515.29 g/mol, XLogP of 3.22, 6 rotatable bonds, 0 hydrogen bond donors, and 8 hydrogen bond acceptors.
Where does this data come from?
All data for ethyl 1-(3-bromophenyl)-4-(2,4-difluorophenyl)sulfonyloxy-6-oxopyridazine-3-carboxylate is sourced from PubChem (CID 16874314), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).